NPs Basic Information
|
Name |
cyclo(l-Val-l-Pro)
|
| Molecular Formula | C10H16N2O2 | |
| IUPAC Name* |
3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
| SMILES |
CC(C)C1NC(=O)C2CCCN2C1=O
|
|
| InChI |
InChI=1S/C10H16N2O2/c1-6(2)8-10(14)12-5-3-4-7(12)9(13)11-8/h6-8H,3-5H2,1-2H3,(H,11,13)/t7-,8-/m0/s1
|
|
| InChIKey |
XLUAWXQORJEMBD-YUMQZZPRSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Physi-Chem Properties
| Molecular Weight: | 196.25 | ALogp: | 0.1 |
| HBD: | 1 | HBA: | 2 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 49.4 | Aromatic Rings: | 2 |
| Heavy Atoms: | 14 | QED Weighted: | 0.665 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.638 | MDCK Permeability: | 0.00000872 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.03 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.021 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.948 | Plasma Protein Binding (PPB): | 28.74% |
| Volume Distribution (VD): | 0.772 | Fu: | 69.96% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.121 |
| CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.753 |
| CYP2C9-inhibitor: | 0.022 | CYP2C9-substrate: | 0.48 |
| CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.208 |
| CYP3A4-inhibitor: | 0.026 | CYP3A4-substrate: | 0.312 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 6.438 | Half-life (T1/2): | 0.764 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.687 |
| Drug-inuced Liver Injury (DILI): | 0.257 | AMES Toxicity: | 0.015 |
| Rat Oral Acute Toxicity: | 0.286 | Maximum Recommended Daily Dose: | 0.037 |
| Skin Sensitization: | 0.082 | Carcinogencity: | 0.028 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.021 |
| Respiratory Toxicity: | 0.046 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
Showing 1 to 10 of 10 entries