|
Name |
investiamide
|
Molecular Formula | C11H15NO2 | |
IUPAC Name* |
N-[2-(4-methoxyphenyl)ethyl]acetamide
|
|
SMILES |
COc1ccc(CCNC(C)=O)cc1
|
|
InChI |
InChI=1S/C11H15NO2/c1-9(13)12-8-7-10-3-5-11(14-2)6-4-10/h3-6H,7-8H2,1-2H3,(H,12,13)
|
|
InChIKey |
VIFWHZYHQSVJGD-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 193.25 | ALogp: | 1.4 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 38.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.792 |
Caco-2 Permeability: | -4.482 | MDCK Permeability: | 0.00002690 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.052 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.964 |
Blood-Brain-Barrier Penetration (BBB): | 0.896 | Plasma Protein Binding (PPB): | 33.91% |
Volume Distribution (VD): | 1.068 | Fu: | 45.47% |
CYP1A2-inhibitor: | 0.857 | CYP1A2-substrate: | 0.923 |
CYP2C19-inhibitor: | 0.746 | CYP2C19-substrate: | 0.888 |
CYP2C9-inhibitor: | 0.11 | CYP2C9-substrate: | 0.723 |
CYP2D6-inhibitor: | 0.613 | CYP2D6-substrate: | 0.889 |
CYP3A4-inhibitor: | 0.163 | CYP3A4-substrate: | 0.408 |
Clearance (CL): | 6.151 | Half-life (T1/2): | 0.748 |
hERG Blockers: | 0.066 | Human Hepatotoxicity (H-HT): | 0.773 |
Drug-inuced Liver Injury (DILI): | 0.143 | AMES Toxicity: | 0.112 |
Rat Oral Acute Toxicity: | 0.037 | Maximum Recommended Daily Dose: | 0.296 |
Skin Sensitization: | 0.25 | Carcinogencity: | 0.288 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.095 |
Respiratory Toxicity: | 0.023 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000870 | 0.667 | D0AN7B | 0.526 | ||||
ENC000201 | 0.533 | D05CKR | 0.450 | ||||
ENC001338 | 0.531 | D03XTC | 0.406 | ||||
ENC000223 | 0.523 | D00WCX | 0.403 | ||||
ENC000693 | 0.521 | D02HXS | 0.400 | ||||
ENC000638 | 0.490 | D01UXC | 0.379 | ||||
ENC000310 | 0.489 | D02AQY | 0.375 | ||||
ENC000298 | 0.469 | D0I2MK | 0.373 | ||||
ENC000221 | 0.455 | D0KD1U | 0.358 | ||||
ENC000106 | 0.442 | D02DPU | 0.355 |