|
Name |
albifipyrrol B
|
Molecular Formula | C16H19NO2 | |
IUPAC Name* |
1-[4-(methoxymethyl)-1-(2-phenylethyl)pyrrol-3-yl]ethanone
|
|
SMILES |
COCc1cn(CCc2ccccc2)cc1C(C)=O
|
|
InChI |
InChI=1S/C16H19NO2/c1-13(18)16-11-17(10-15(16)12-19-2)9-8-14-6-4-3-5-7-14/h3-7,10-11H,8-9,12H2,1-2H3
|
|
InChIKey |
ZPRIWYFNNIMJKI-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 257.33 | ALogp: | 3.1 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 31.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.736 |
Caco-2 Permeability: | -4.433 | MDCK Permeability: | 0.00003220 |
Pgp-inhibitor: | 0.975 | Pgp-substrate: | 0.023 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.332 |
Blood-Brain-Barrier Penetration (BBB): | 0.867 | Plasma Protein Binding (PPB): | 54.26% |
Volume Distribution (VD): | 2.31 | Fu: | 41.04% |
CYP1A2-inhibitor: | 0.955 | CYP1A2-substrate: | 0.845 |
CYP2C19-inhibitor: | 0.958 | CYP2C19-substrate: | 0.079 |
CYP2C9-inhibitor: | 0.801 | CYP2C9-substrate: | 0.077 |
CYP2D6-inhibitor: | 0.759 | CYP2D6-substrate: | 0.25 |
CYP3A4-inhibitor: | 0.257 | CYP3A4-substrate: | 0.588 |
Clearance (CL): | 7.583 | Half-life (T1/2): | 0.656 |
hERG Blockers: | 0.064 | Human Hepatotoxicity (H-HT): | 0.179 |
Drug-inuced Liver Injury (DILI): | 0.909 | AMES Toxicity: | 0.731 |
Rat Oral Acute Toxicity: | 0.466 | Maximum Recommended Daily Dose: | 0.444 |
Skin Sensitization: | 0.267 | Carcinogencity: | 0.822 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.051 |
Respiratory Toxicity: | 0.023 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004481 | 0.780 | D0P2GK | 0.391 | ||||
ENC000598 | 0.444 | D05OFX | 0.368 | ||||
ENC000216 | 0.443 | D0G1VX | 0.347 | ||||
ENC000597 | 0.422 | D0KS6W | 0.346 | ||||
ENC000693 | 0.419 | D0A8XN | 0.344 | ||||
ENC000779 | 0.419 | D0J2KV | 0.340 | ||||
ENC000308 | 0.417 | D0P9AC | 0.339 | ||||
ENC005605 | 0.400 | D00DZN | 0.338 | ||||
ENC000215 | 0.400 | D0E1WI | 0.337 | ||||
ENC000596 | 0.397 | D0X6HD | 0.330 |