|
Name |
albifipyrrol A
|
Molecular Formula | C15H17NO2 | |
IUPAC Name* |
1-[4-(hydroxymethyl)-1-(2-phenylethyl)pyrrol-3-yl]ethanone
|
|
SMILES |
CC(=O)c1cn(CCc2ccccc2)cc1CO
|
|
InChI |
InChI=1S/C15H17NO2/c1-12(18)15-10-16(9-14(15)11-17)8-7-13-5-3-2-4-6-13/h2-6,9-10,17H,7-8,11H2,1H3
|
|
InChIKey |
LLADVOIAYSMBQR-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 243.31 | ALogp: | 2.4 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 42.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.819 |
Caco-2 Permeability: | -4.36 | MDCK Permeability: | 0.00002570 |
Pgp-inhibitor: | 0.152 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.034 |
30% Bioavailability (F30%): | 0.026 |
Blood-Brain-Barrier Penetration (BBB): | 0.512 | Plasma Protein Binding (PPB): | 50.25% |
Volume Distribution (VD): | 2.486 | Fu: | 51.21% |
CYP1A2-inhibitor: | 0.971 | CYP1A2-substrate: | 0.755 |
CYP2C19-inhibitor: | 0.938 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.607 | CYP2C9-substrate: | 0.1 |
CYP2D6-inhibitor: | 0.854 | CYP2D6-substrate: | 0.294 |
CYP3A4-inhibitor: | 0.194 | CYP3A4-substrate: | 0.515 |
Clearance (CL): | 7.476 | Half-life (T1/2): | 0.91 |
hERG Blockers: | 0.048 | Human Hepatotoxicity (H-HT): | 0.122 |
Drug-inuced Liver Injury (DILI): | 0.941 | AMES Toxicity: | 0.466 |
Rat Oral Acute Toxicity: | 0.164 | Maximum Recommended Daily Dose: | 0.419 |
Skin Sensitization: | 0.334 | Carcinogencity: | 0.717 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.098 |
Respiratory Toxicity: | 0.027 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004482 | 0.780 | D0P2GK | 0.410 | ||||
ENC004483 | 0.448 | D05OIS | 0.396 | ||||
ENC000598 | 0.443 | D0A8XN | 0.372 | ||||
ENC000693 | 0.441 | D0P9AC | 0.356 | ||||
ENC000216 | 0.441 | D0R1CR | 0.355 | ||||
ENC000779 | 0.441 | D00DZN | 0.354 | ||||
ENC000004 | 0.439 | D0J2KV | 0.352 | ||||
ENC000128 | 0.426 | D0E1WI | 0.348 | ||||
ENC000597 | 0.419 | D0I2VK | 0.333 | ||||
ENC000218 | 0.411 | D04XGT | 0.329 |