|
Name |
Botryosulfuranol A
|
Molecular Formula | C21H22N2O6S2 | |
IUPAC Name* |
NA
|
|
SMILES |
CN1C(=O)[C@@]2([C@@H]([C@@]3(CCC=CC3=O)ON2C(=O)[C@@]14[C@H](C5=CC=CC=C5O4)SC)O)SC
|
|
InChI |
InChI=1S/C21H22N2O6S2/c1-22-18(27)21(31-3)16(25)19(11-7-6-10-14(19)24)29-23(21)17(26)20(22)15(30-2)12-8-4-5-9-13(12)28-20/h4-6,8-10,15-16,25H,7,11H2,1-3H3/t15-,16+,19-,20-,21+/m0/s1
|
|
InChIKey |
FWQZEHMYXPCCOA-CEDHKZHLSA-N
|
|
Synonyms |
Botryosulfuranol A; CHEMBL4758185
|
|
CAS | NA | |
PubChem CID | 146682373 | |
ChEMBL ID | CHEMBL4758185 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 462.5 | ALogp: | 1.4 |
HBD: | 1 | HBA: | 8 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 147.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 31 | QED Weighted: | 0.713 |
Caco-2 Permeability: | -5.151 | MDCK Permeability: | 0.00001780 |
Pgp-inhibitor: | 0.806 | Pgp-substrate: | 0.49 |
Human Intestinal Absorption (HIA): | 0.775 | 20% Bioavailability (F20%): | 0.078 |
30% Bioavailability (F30%): | 0.592 |
Blood-Brain-Barrier Penetration (BBB): | 0.797 | Plasma Protein Binding (PPB): | 79.79% |
Volume Distribution (VD): | 1.166 | Fu: | 16.24% |
CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.929 |
CYP2C19-inhibitor: | 0.122 | CYP2C19-substrate: | 0.911 |
CYP2C9-inhibitor: | 0.383 | CYP2C9-substrate: | 0.117 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.088 |
CYP3A4-inhibitor: | 0.295 | CYP3A4-substrate: | 0.943 |
Clearance (CL): | 6.51 | Half-life (T1/2): | 0.817 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.243 |
Drug-inuced Liver Injury (DILI): | 0.97 | AMES Toxicity: | 0.818 |
Rat Oral Acute Toxicity: | 0.995 | Maximum Recommended Daily Dose: | 0.085 |
Skin Sensitization: | 0.895 | Carcinogencity: | 0.903 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.335 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004040 | 0.755 | D00JRA | 0.252 | ||||
ENC004041 | 0.663 | D08UMH | 0.250 | ||||
ENC003549 | 0.421 | D08EOD | 0.245 | ||||
ENC003595 | 0.385 | D0E3WQ | 0.242 | ||||
ENC003539 | 0.373 | D05MQK | 0.232 | ||||
ENC003546 | 0.373 | D08CCE | 0.227 | ||||
ENC003438 | 0.322 | D07RGW | 0.226 | ||||
ENC003035 | 0.308 | D06BYV | 0.225 | ||||
ENC004277 | 0.297 | D0W7RJ | 0.223 | ||||
ENC003439 | 0.290 | D09NNH | 0.223 |