|
Name |
Penicisulfuranol D
|
Molecular Formula | C23H27ClN2O8S2 | |
IUPAC Name* |
(2R,3R,6'aS,7'R,10'R,10'aR,11'aR)-10'-chloro-7',10'a-dihydroxy-6,7-dimethoxy-2'-methyl-3,11'a-bis(methylsulfanyl)spiro[3H-1-benzofuran-2,3'-6a,7,10,11-tetrahydropyrazino[1,2-b][1,2]benzoxazine]-1',4'-dione
|
|
SMILES |
CN1C(=O)[C@@]2(C[C@@]3([C@@H](C=C[C@H]([C@@H]3ON2C(=O)[C@@]14[C@@H](C5=C(O4)C(=C(C=C5)OC)OC)SC)O)Cl)O)SC
|
|
InChI |
InChI=1S/C23H27ClN2O8S2/c1-25-19(28)22(36-5)10-21(30)14(24)9-7-12(27)17(21)34-26(22)20(29)23(25)18(35-4)11-6-8-13(31-2)16(32-3)15(11)33-23/h6-9,12,14,17-18,27,30H,10H2,1-5H3/t12-,14-,17+,18-,21+,22-,23+/m1/s1
|
|
InChIKey |
RVQNEXGEFBVNJZ-IXFSHVHNSA-N
|
|
Synonyms |
Penicisulfuranol D; CHEMBL4095104
|
|
CAS | NA | |
PubChem CID | 137654314 | |
ChEMBL ID | CHEMBL4095104 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 559.1 | ALogp: | 1.1 |
HBD: | 2 | HBA: | 10 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 169.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 36 | QED Weighted: | 0.42 |
Caco-2 Permeability: | -5.132 | MDCK Permeability: | 0.00001480 |
Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.734 |
Human Intestinal Absorption (HIA): | 0.882 | 20% Bioavailability (F20%): | 0.375 |
30% Bioavailability (F30%): | 0.641 |
Blood-Brain-Barrier Penetration (BBB): | 0.291 | Plasma Protein Binding (PPB): | 93.75% |
Volume Distribution (VD): | 1.278 | Fu: | 3.37% |
CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.95 |
CYP2C19-inhibitor: | 0.06 | CYP2C19-substrate: | 0.9 |
CYP2C9-inhibitor: | 0.25 | CYP2C9-substrate: | 0.109 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.088 |
CYP3A4-inhibitor: | 0.745 | CYP3A4-substrate: | 0.953 |
Clearance (CL): | 4.052 | Half-life (T1/2): | 0.817 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.318 |
Drug-inuced Liver Injury (DILI): | 0.973 | AMES Toxicity: | 0.313 |
Rat Oral Acute Toxicity: | 0.908 | Maximum Recommended Daily Dose: | 0.062 |
Skin Sensitization: | 0.354 | Carcinogencity: | 0.836 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.016 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003539 | 0.885 | D03DIG | 0.288 | ||||
ENC003549 | 0.721 | D0L1JW | 0.271 | ||||
ENC003544 | 0.699 | D04TDQ | 0.271 | ||||
ENC003595 | 0.684 | D0D4HN | 0.236 | ||||
ENC003545 | 0.613 | D09DHY | 0.236 | ||||
ENC003540 | 0.598 | D02LZB | 0.236 | ||||
ENC004277 | 0.592 | D0C1SF | 0.235 | ||||
ENC003738 | 0.532 | D0WE3O | 0.234 | ||||
ENC003659 | 0.432 | D01FFA | 0.229 | ||||
ENC004276 | 0.415 | D06GCK | 0.228 |