|
Name |
Penispirozine B
|
Molecular Formula | C22H26N2O8S2 | |
IUPAC Name* |
NA
|
|
SMILES |
CN1C(=O)[C@]2(C[C@@]3([C@@H](S2)C=C[C@H]([C@@H]3O)O)O)NC(=O)[C@@]14[C@@H](C5=C(O4)C(=C(C=C5)OC)OC)SC
|
|
InChI |
InChI=1S/C22H26N2O8S2/c1-24-19(28)21(9-20(29)13(34-21)8-6-11(25)16(20)26)23-18(27)22(24)17(33-4)10-5-7-12(30-2)15(31-3)14(10)32-22/h5-8,11,13,16-17,25-26,29H,9H2,1-4H3,(H,23,27)/t11-,13+,16+,17-,20+,21-,22+/m1/s1
|
|
InChIKey |
WYZUOAVZOKJFKT-QBVCGWBQSA-N
|
|
Synonyms |
Penispirozine B
|
|
CAS | NA | |
PubChem CID | 156580831 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 510.6 | ALogp: | -0.4 |
HBD: | 4 | HBA: | 10 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 188.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 34 | QED Weighted: | 0.423 |
Caco-2 Permeability: | -5.516 | MDCK Permeability: | 0.00000800 |
Pgp-inhibitor: | 0.847 | Pgp-substrate: | 0.986 |
Human Intestinal Absorption (HIA): | 0.873 | 20% Bioavailability (F20%): | 0.352 |
30% Bioavailability (F30%): | 0.886 |
Blood-Brain-Barrier Penetration (BBB): | 0.701 | Plasma Protein Binding (PPB): | 90.58% |
Volume Distribution (VD): | 1.187 | Fu: | 4.43% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.93 |
CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.838 |
CYP2C9-inhibitor: | 0.044 | CYP2C9-substrate: | 0.092 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.1 |
CYP3A4-inhibitor: | 0.386 | CYP3A4-substrate: | 0.94 |
Clearance (CL): | 2.854 | Half-life (T1/2): | 0.732 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.03 |
Drug-inuced Liver Injury (DILI): | 0.946 | AMES Toxicity: | 0.058 |
Rat Oral Acute Toxicity: | 0.978 | Maximum Recommended Daily Dose: | 0.466 |
Skin Sensitization: | 0.139 | Carcinogencity: | 0.382 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.032 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003539 | 0.619 | D03DIG | 0.279 | ||||
ENC003546 | 0.592 | D0L1JW | 0.272 | ||||
ENC004278 | 0.548 | D04TDQ | 0.271 | ||||
ENC004279 | 0.548 | D06TQZ | 0.244 | ||||
ENC003545 | 0.545 | D01FFA | 0.237 | ||||
ENC003540 | 0.532 | D06GCK | 0.237 | ||||
ENC003544 | 0.520 | D0D4HN | 0.236 | ||||
ENC003595 | 0.508 | D09DHY | 0.236 | ||||
ENC003549 | 0.500 | D02LZB | 0.235 | ||||
ENC004282 | 0.475 | D0C1SF | 0.234 |