NPs Basic Information
|
Name |
N-(4-Hydroxy-2-methoxyphenyl)acetamide
|
| Molecular Formula | C9H11NO3 | |
| IUPAC Name* |
N-(4-hydroxy-2-methoxyphenyl)acetamide
|
|
| SMILES |
CC(=O)NC1=C(C=C(C=C1)O)OC
|
|
| InChI |
InChI=1S/C9H11NO3/c1-6(11)10-8-4-3-7(12)5-9(8)13-2/h3-5,12H,1-2H3,(H,10,11)
|
|
| InChIKey |
WSLZRANFLVSYSP-UHFFFAOYSA-N
|
|
| Synonyms |
N-(4-Hydroxy-2-methoxyphenyl)acetamide; 5307-06-2; 4-Acetylamino-3-methoxyphenol; SCHEMBL14782205; DTXSID90738724; N-(4-hydroxy-2-methoxyphenyl) acetamide
|
|
| CAS | 5307-06-2 | |
| PubChem CID | 68646525 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 181.19 | ALogp: | 1.0 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 58.6 | Aromatic Rings: | 1 |
| Heavy Atoms: | 13 | QED Weighted: | 0.684 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.539 | MDCK Permeability: | 0.00001010 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.641 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.805 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.925 | Plasma Protein Binding (PPB): | 13.84% |
| Volume Distribution (VD): | 0.8 | Fu: | 69.56% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.518 | CYP1A2-substrate: | 0.878 |
| CYP2C19-inhibitor: | 0.06 | CYP2C19-substrate: | 0.528 |
| CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.88 |
| CYP2D6-inhibitor: | 0.027 | CYP2D6-substrate: | 0.792 |
| CYP3A4-inhibitor: | 0.021 | CYP3A4-substrate: | 0.361 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 9.944 | Half-life (T1/2): | 0.908 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.577 |
| Drug-inuced Liver Injury (DILI): | 0.645 | AMES Toxicity: | 0.158 |
| Rat Oral Acute Toxicity: | 0.037 | Maximum Recommended Daily Dose: | 0.237 |
| Skin Sensitization: | 0.598 | Carcinogencity: | 0.146 |
| Eye Corrosion: | 0.01 | Eye Irritation: | 0.644 |
| Respiratory Toxicity: | 0.053 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002213 |  |
0.556 | D0U5QK |  |
0.444 | ||
| ENC000501 |  |
0.512 | D0E9CD |  |
0.383 | ||
| ENC000391 |  |
0.449 | D02XJY |  |
0.333 | ||
| ENC000072 |  |
0.444 | D0AN7B |  |
0.317 | ||
| ENC001056 |  |
0.426 | D02AQY |  |
0.304 | ||
| ENC001055 |  |
0.426 | D0U5CE |  |
0.297 | ||
| ENC000296 |  |
0.426 | D03LGG |  |
0.297 | ||
| ENC000344 |  |
0.422 | D0YF3X |  |
0.295 | ||
| ENC000172 |  |
0.409 | D09GYT |  |
0.293 | ||
| ENC000777 |  |
0.400 | D0U0OT |  |
0.293 | ||