|
Name |
N-[(2R,3R,4R,5S,6R)-2-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide
|
Molecular Formula | C8H16N2O5 | |
IUPAC Name* |
N-[(2R,3R,4R,5S,6R)-2-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide
|
|
SMILES |
CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1N)CO)O)O
|
|
InChI |
InChI=1S/C8H16N2O5/c1-3(12)10-5-7(14)6(13)4(2-11)15-8(5)9/h4-8,11,13-14H,2,9H2,1H3,(H,10,12)/t4-,5-,6-,7-,8-/m1/s1
|
|
InChIKey |
MCGXOCXFFNKASF-FMDGEEDCSA-N
|
|
Synonyms |
18615-50-4; 2-acetamido-2-deoxy-beta-D-glucopyranosylamine; 4229-38-3; N-Acetyl-beta-D-glucosaminylamine; 2-Acetamido-2-deoxy-beta-D-glucosylamine; 2-Acetamido-2-deoxy-b-D-glucosylamine; N-Acetyl-b-glucosaminylamine; N-acetyl-beta-glucosaminylamine; 2-Acetamido-2-deoxy-b-D-glucopyranosyl amine; N-[(2R,3R,4R,5S,6R)-2-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide; 2-Acetamido-1-amino-1,2-dideoxy-beta-D-glucopyranose; 114910-04-2; 112339-01-2; 112339-04-5; N-((2R,3R,4R,5S,6R)-2-AMINO-4,5-DIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-3-YL)ACETAMIDE; .beta.-D-ribo-Hexopyranose, 1,6-anhydro-3-deoxy-2-S-methyl-4-O-(phenylmethyl)-2-thio-; .beta.-D-erythro-Hexopyranos-2-ulose, 1,6-anhydro-3-deoxy-4-O-(phenylmethyl)-, dimethyl acetal; 1-Naphthalenediazonium, 4-[[4-[(4-nitro-2-sulfophenyl) amino]phenyl]azo]-6-sulfo-, chloride, reactio; N-acetyl-b-D-glucosaminylamine; SCHEMBL6036803; CHEBI:15947; DTXSID101036106; MFCD00057751; N-acetyl-beta-delta-glucosaminylamine; ZINC53193391; CS-0452428; 2-Acetamido-2-deoxy-|A-D-glucopyranosylamine; C01239; 229A383; W-202730; Q27098314; N-[2-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]ethanamide; WURCS=2.0/1,1,0/[a2122h-1b_1-5_1*N_2*NCC/3=O]/1/
|
|
CAS | 114910-04-2 | |
PubChem CID | 439454 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 220.22 | ALogp: | -2.0 |
HBD: | 5 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 125.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.347 |
Caco-2 Permeability: | -5.392 | MDCK Permeability: | 0.00011788 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.796 |
Human Intestinal Absorption (HIA): | 0.862 | 20% Bioavailability (F20%): | 0.27 |
30% Bioavailability (F30%): | 0.932 |
Blood-Brain-Barrier Penetration (BBB): | 0.161 | Plasma Protein Binding (PPB): | 12.25% |
Volume Distribution (VD): | 0.385 | Fu: | 89.36% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.022 |
CYP2C19-inhibitor: | 0.029 | CYP2C19-substrate: | 0.065 |
CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.032 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.103 |
CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.056 |
Clearance (CL): | 1.885 | Half-life (T1/2): | 0.84 |
hERG Blockers: | 0.045 | Human Hepatotoxicity (H-HT): | 0.244 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.462 |
Rat Oral Acute Toxicity: | 0.004 | Maximum Recommended Daily Dose: | 0.004 |
Skin Sensitization: | 0.097 | Carcinogencity: | 0.015 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.033 |
Respiratory Toxicity: | 0.027 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000661 | 0.429 | D05ZYM | 0.733 | ||||
ENC001062 | 0.407 | D0I8RR | 0.509 | ||||
ENC003068 | 0.407 | D07NSU | 0.489 | ||||
ENC003055 | 0.393 | D0H2RI | 0.429 | ||||
ENC004291 | 0.377 | D0H3KI | 0.429 | ||||
ENC005771 | 0.367 | D02HYK | 0.403 | ||||
ENC000851 | 0.367 | D0S7DV | 0.393 | ||||
ENC005772 | 0.357 | D0H3WI | 0.393 | ||||
ENC003177 | 0.338 | D0G5AG | 0.381 | ||||
ENC000126 | 0.328 | D0Z4EI | 0.360 |