|
Name |
3,4-Dihydroxyphenylacetic acid
|
Molecular Formula | C8H8O4 | |
IUPAC Name* |
2-(3,4-dihydroxyphenyl)acetic acid
|
|
SMILES |
C1=CC(=C(C=C1CC(=O)O)O)O
|
|
InChI |
InChI=1S/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)
|
|
InChIKey |
CFFZDZCDUFSOFZ-UHFFFAOYSA-N
|
|
Synonyms |
3,4-Dihydroxyphenylacetic acid; 102-32-9; Dopac; 2-(3,4-DIHYDROXYPHENYL)ACETIC ACID; Homoprotocatechuic acid; Dopacetic acid; 3,4-Dihydroxybenzeneacetic acid; Benzeneacetic acid, 3,4-dihydroxy-; Dihydroxyphenylacetic acid; (3,4-DIHYDROXYPHENYL)ACETIC ACID; Homoprotocatechuate; Acetic acid, (3,4-dihydroxyphenyl)-; 3,4-Dihydroxy-phenylacetic acid; 3,4-dihydroxyphenylacetate; BA 2773; 3,4-DIHYDROXYPHENYLACETICACID; MFCD00004338; Lopac-D-9128; KEX5N0R4N5; 3,4-DHPOP; MLS001056737; 3,4-dihydroxyphenyl acetic acid; CHEBI:41941; NSC-73191; 3,4-DIHYDROXYPHENYLCAETIC ACID; SMR000326727; 4-Carboxymethylcatechol; DHY; 3,4-Dihydroxyphenylacetate, XV; 2-(3,4-dihydroxyphenyl)acetate; CCRIS 3765; Catechol-4-acetic Acid; EINECS 203-024-1; NSC 73191; UNII-KEX5N0R4N5; BRN 2211017; Dopacetate; AI3-52339; 3pcn; Dihydroxyphenylacetate; 1ai4; cid_547; 4-Carboxymethylpyrocatechol; bmse000329; Pyrocatechol-4-acetic Acid; 3,4-Dihydroxybenzeneacetate; CHEMBL1284; NCIOpen2_000518; Lopac0_000414; SCHEMBL36348; Benzeneacetic acid,4-dihydroxy-; DTXSID9074430; Acetic acid,4-dihydroxyphenyl)-; BDBM52946; HMDB01336; 3,4-dihydroxy-Benzeneacetic acid; 3,4-dihydroxyl phenylacetic acid; HMS2233I20; HMS3261C10; HMS3373A01; KUC106695N; KUC106697N; ZINC388555; (3,4-dihydroxyphenyl)-Acetic acid; NSC73191; Tox21_500414; s5639; 3,4-Dihydroxyphenylacetic acid, 98%; AKOS015890264; AC-5292; CCG-204506; CS-W001080; DB01702; Dopac/(3,4-dihydroxyphenyl)-aceticaci; HY-W001080; LP00414; RS-1018; SDCCGSBI-0050399.P002; Acetic acid, (3,4-dihydroxyphenyl)-,; NCGC00015381-01; NCGC00015381-02; NCGC00015381-03; NCGC00015381-04; NCGC00015381-05; NCGC00015381-06; NCGC00093838-01; NCGC00093838-02; NCGC00093838-03; NCGC00261099-01; HAA; KSC-11-207-5; KSC-11-207-8; SY015718; 2-[3,4-bis(oxidanyl)phenyl]ethanoic acid; AM20020093; D1283; EU-0100414; FT-0614331; 3,4-Dihydroxyphenylacetic Acid-[13C,18O2]; C01161; D 9128; EN300-111909; A800559; SR-01000075841; 3,4-Dihydroxyphenylacetic acid, analytical standard; J-000672; Q4634071; SR-01000075841-1; Z1255438427; 47115C80-8C82-419A-BC51-B10A2CB7FE8F
|
|
CAS | 102-32-9 | |
PubChem CID | 547 | |
ChEMBL ID | CHEMBL1284 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 168.15 | ALogp: | 0.5 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.578 |
Caco-2 Permeability: | -5.317 | MDCK Permeability: | 0.00001840 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.041 | 20% Bioavailability (F20%): | 0.573 |
30% Bioavailability (F30%): | 0.045 |
Blood-Brain-Barrier Penetration (BBB): | 0.071 | Plasma Protein Binding (PPB): | 58.46% |
Volume Distribution (VD): | 0.337 | Fu: | 33.64% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.084 |
CYP2C19-inhibitor: | 0.035 | CYP2C19-substrate: | 0.056 |
CYP2C9-inhibitor: | 0.052 | CYP2C9-substrate: | 0.853 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.235 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.073 |
Clearance (CL): | 17.407 | Half-life (T1/2): | 0.94 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.2 |
Drug-inuced Liver Injury (DILI): | 0.836 | AMES Toxicity: | 0.638 |
Rat Oral Acute Toxicity: | 0.103 | Maximum Recommended Daily Dose: | 0.007 |
Skin Sensitization: | 0.801 | Carcinogencity: | 0.17 |
Eye Corrosion: | 0.903 | Eye Irritation: | 0.964 |
Respiratory Toxicity: | 0.1 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000862 | 0.684 | D08HVR | 0.643 | ||||
ENC002095 | 0.675 | D0BA6T | 0.614 | ||||
ENC000127 | 0.643 | D0P7JZ | 0.574 | ||||
ENC000002 | 0.605 | D0T7OW | 0.550 | ||||
ENC001440 | 0.523 | D0U0OT | 0.532 | ||||
ENC000006 | 0.512 | D0V9EN | 0.523 | ||||
ENC002317 | 0.488 | D0I3RO | 0.479 | ||||
ENC000097 | 0.488 | D0Y6KO | 0.472 | ||||
ENC000329 | 0.474 | D07MOX | 0.455 | ||||
ENC000069 | 0.452 | D0C6OQ | 0.431 |