|
Name |
4-Allylphenol
|
Molecular Formula | C9H10O | |
IUPAC Name* |
4-prop-2-enylphenol
|
|
SMILES |
C=CCC1=CC=C(C=C1)O
|
|
InChI |
InChI=1S/C9H10O/c1-2-3-8-4-6-9(10)7-5-8/h2,4-7,10H,1,3H2
|
|
InChIKey |
RGIBXDHONMXTLI-UHFFFAOYSA-N
|
|
Synonyms |
4-Allylphenol; Chavicol; 501-92-8; p-Allylphenol; p-Hydroxyallylbenzene; Phenol, 4-(2-propenyl)-; 4-prop-2-enylphenol; Phenol, p-allyl-; 4-(prop-2-en-1-yl)phenol; p-Chavicol; 4-(2-Propenyl)phenol; gamma-(p-Hydroxyphenyl)-alpha-propylene; 4-(Prop-2-enyl)-phenol; 4-Allyl-Phenol; 3-(4-Hydroxyphenyl)-1-propene; .gamma.-(p-Hydroxyphenyl)-.alpha.-propylene; CHEBI:50158; Q5ER4K6969; MFCD01940501; NSC-290195; CCRIS 3208; EINECS 207-929-2; NSC 290195; UNII-Q5ER4K6969; alpha -propylene; p-Allyl-Phenol; p-Hydroxyallylpropene; CHAVICOL [MI]; 4-(2-propenyl)-phenol; Phenol, p-allyl- (8CI); SCHEMBL30870; 4-ALLYLPHENOL [FHFI]; CHEMBL108862; 3-(p-Hydroxyphenyl)-1-propene; FEMA NO. 4075; RGIBXDHONMXTLI-UHFFFAOYSA-; DTXSID60198210; ZINC1565456; AC1877; NSC290195; Phenol, 4-(2-propenyl)- (9CI); AKOS006278514; CS-12298; SY045829; DB-106539; C3743; CS-0217169; C16930; EN300-698378; 501A928; A917800; laquo gammaRaquo -(p-hydroxyphenyl)-alpha -propylene; Q2504388
|
|
CAS | 501-92-8 | |
PubChem CID | 68148 | |
ChEMBL ID | CHEMBL108862 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 134.17 | ALogp: | 2.9 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.616 |
Caco-2 Permeability: | -4.377 | MDCK Permeability: | 0.00002970 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.884 |
30% Bioavailability (F30%): | 0.91 |
Blood-Brain-Barrier Penetration (BBB): | 0.126 | Plasma Protein Binding (PPB): | 89.82% |
Volume Distribution (VD): | 0.828 | Fu: | 6.39% |
CYP1A2-inhibitor: | 0.899 | CYP1A2-substrate: | 0.586 |
CYP2C19-inhibitor: | 0.783 | CYP2C19-substrate: | 0.365 |
CYP2C9-inhibitor: | 0.265 | CYP2C9-substrate: | 0.877 |
CYP2D6-inhibitor: | 0.771 | CYP2D6-substrate: | 0.9 |
CYP3A4-inhibitor: | 0.134 | CYP3A4-substrate: | 0.308 |
Clearance (CL): | 15.156 | Half-life (T1/2): | 0.889 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.031 |
Drug-inuced Liver Injury (DILI): | 0.029 | AMES Toxicity: | 0.076 |
Rat Oral Acute Toxicity: | 0.219 | Maximum Recommended Daily Dose: | 0.096 |
Skin Sensitization: | 0.888 | Carcinogencity: | 0.569 |
Eye Corrosion: | 0.918 | Eye Irritation: | 0.99 |
Respiratory Toxicity: | 0.189 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000310 | 0.595 | D0W1RY | 0.513 | ||||
ENC000350 | 0.556 | D03UOT | 0.471 | ||||
ENC000740 | 0.556 | D01CRB | 0.465 | ||||
ENC000006 | 0.526 | D0B3QM | 0.444 | ||||
ENC000774 | 0.526 | D0S2BV | 0.400 | ||||
ENC004860 | 0.488 | D0U5QK | 0.381 | ||||
ENC000005 | 0.472 | D0H6TP | 0.333 | ||||
ENC000086 | 0.471 | D02WAB | 0.327 | ||||
ENC001021 | 0.471 | D0K1QD | 0.304 | ||||
ENC000129 | 0.465 | D00LFB | 0.299 |