|
Name |
1-Methylpyrrole-2-carboxaldehyde
|
Molecular Formula | C6H7NO | |
IUPAC Name* |
1-methylpyrrole-2-carbaldehyde
|
|
SMILES |
CN1C=CC=C1C=O
|
|
InChI |
InChI=1S/C6H7NO/c1-7-4-2-3-6(7)5-8/h2-5H,1H3
|
|
InChIKey |
OUKQTRFCDKSEPL-UHFFFAOYSA-N
|
|
Synonyms |
1192-58-1; 1-Methylpyrrole-2-carboxaldehyde; 1-Methyl-1H-pyrrole-2-carbaldehyde; N-Methylpyrrole-2-carboxaldehyde; 1-Methylpyrrole-2-carbaldehyde; N-Methyl-2-pyrrolecarboxaldehyde; 1-Methyl-1H-pyrrole-2-carboxaldehyde; 2-Formyl-1-methylpyrrole; 1-Methyl-2-pyrrolecarboxaldehyde; 1H-Pyrrole-2-carboxaldehyde, 1-methyl-; 1-Methyl-2-formylpyrrole; NSC 72386; 1H-Pyrrolecarboxaldehyde, 1-methyl-; M0HYH3D7SX; 1-Methyl-2-pyrrolaldehyde; N-methylpyrrole-2-carbaldehyde; N-METHYL-2-FORMYLPYRROLE; 1-methylpyrrole-2-carboxyaldehyde; N-Methylpyrrole-2-carboxy aldehyde; NSC-72386; EINECS 214-755-0; UNII-M0HYH3D7SX; 1-Methylpyrrole-2-aldehyde; BRN 0107811; 1-methylpyrrol-2-carbaldehyde; NSC72386; MFCD00003087; 1-Methylformylpyrrole; N-Methylpyrrole-2-aldehyde; WLN: T5NJ A1 BVH; 5-21-07-00177 (Beilstein Handbook Reference); SCHEMBL260478; n-methyl-2-pyrrolecarbaldehyde; 1methyl-2-pyrrolecarboxaldehyde; N-methylpyrrol-2-carboxaldehyde; 1-Methyl-2-formyl-1H-pyrrole; CHEMBL2229659; FEMA NO. 4332; DTXSID20152338; methyl-1H-pyrrole-2-carbaldehyde; 1-methyl pyrrole-2-carboxaldehyde; 1-methyl-2-pyrrole carboxaldehyde; CHEBI:193607; 1-Methyl-Pyrrole-2-carboxaldehyde; ZINC130187; 1-methyl-1H-pyrrol-2-carbaldehyde; AMY19098; BBL001423; Pyrrole-2-carboxaldehyde, 1-methyl-; STK802640; AKOS000113751; CS-W021362; DS-1305; SB62009; N-Methyl-2-pyrrolecarboxaldehyde, 98%; FT-0608096; M1119; EN300-20969; P15926; W-108523; 1-METHYL-1H-PYRROLE-2-CARBOXALDEHYDE [FHFI]; N-Methyl-2-pyrrolecarboxaldehyde, analytical standard; Q27283313; F2190-0578; Z104485562
|
|
CAS | 1192-58-1 | |
PubChem CID | 14504 | |
ChEMBL ID | CHEMBL2229659 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 109.13 | ALogp: | 0.5 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 22.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 8 | QED Weighted: | 0.497 |
Caco-2 Permeability: | -4.524 | MDCK Permeability: | 0.00002350 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.053 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.01 |
Blood-Brain-Barrier Penetration (BBB): | 0.897 | Plasma Protein Binding (PPB): | 23.51% |
Volume Distribution (VD): | 1.724 | Fu: | 76.75% |
CYP1A2-inhibitor: | 0.897 | CYP1A2-substrate: | 0.757 |
CYP2C19-inhibitor: | 0.099 | CYP2C19-substrate: | 0.53 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.262 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.501 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.246 |
Clearance (CL): | 9.187 | Half-life (T1/2): | 0.839 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.102 |
Drug-inuced Liver Injury (DILI): | 0.039 | AMES Toxicity: | 0.05 |
Rat Oral Acute Toxicity: | 0.075 | Maximum Recommended Daily Dose: | 0.115 |
Skin Sensitization: | 0.105 | Carcinogencity: | 0.224 |
Eye Corrosion: | 0.438 | Eye Irritation: | 0.893 |
Respiratory Toxicity: | 0.783 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000640 | 0.438 | D0N0OU | 0.263 | ||||
ENC000190 | 0.313 | D0S4BR | 0.242 | ||||
ENC000414 | 0.306 | D0E9CD | 0.238 | ||||
ENC001334 | 0.289 | D0TY5N | 0.204 | ||||
ENC000012 | 0.286 | D0O7JW | 0.203 | ||||
ENC000166 | 0.270 | D02CKX | 0.200 | ||||
ENC000412 | 0.257 | D06BYV | 0.196 | ||||
ENC000552 | 0.256 | D08EOD | 0.189 | ||||
ENC000649 | 0.256 | D05QIM | 0.188 | ||||
ENC001839 | 0.250 | D0X7NU | 0.186 |