|
Name |
Orcinol
|
Molecular Formula | C7H8O2 | |
IUPAC Name* |
5-methylbenzene-1,3-diol
|
|
SMILES |
CC1=CC(=CC(=C1)O)O
|
|
InChI |
InChI=1S/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3
|
|
InChIKey |
OIPPWFOQEKKFEE-UHFFFAOYSA-N
|
|
Synonyms |
Orcinol; 3,5-Dihydroxytoluene; 504-15-4; 5-methylbenzene-1,3-diol; 5-METHYLRESORCINOL; 1,3-Dihydroxy-5-methylbenzene; Orcin; 5-Methyl-1,3-benzenediol; 5-Methylresorcin; 1,3-Benzenediol, 5-methyl-; 3-Hydroxy-5-methylphenol; 3,5-Toluenediol; Resorcinol, 5-methyl-; Orcinol, 5-methylresorcinol; 5-Methyl Resorcinol; Oricinol; MFCD00002291; NSC 12441; 5-Methyl-1,3-dihydroxybenzene; CHEBI:16536; 3,5-Dihydroxy-toluene; 5-Methyl-benzene-1,3-diol; NSC-12441; 534PMB3438; EINECS 207-984-2; 5-Methylresorcinol anhydrous; BRN 1071903; Orcine; AI3-23954; UNII-534PMB3438; 5-methyl-resorcinol; resorcinol monohydrate; 3,5-ToluenediolOrcin; Orcinol, 97%; ORCINOL [MI]; 5-methylbenzen-1,3-diol; WLN: QR CQ E1; SCHEMBL68497; 4-06-00-05892 (Beilstein Handbook Reference); 5-Methylresorcinol, anhydrous; CHEMBL110059; DTXSID2060123; 5-methylbenzene-1,3-diol;Orcinol; ZINC391826; HY-D0168; NSC12441; BBL027377; BDBM50104667; c0155; s9329; STL146540; AKOS000280922; 1,5-DIHYDROXY-3-METHYLBENZENE; CCG-266088; CS-W008652; SC10142; AC-10290; AS-14515; SY002780; DB-022064; FT-0620669; M0426; M1235; EN300-67390; C00727; H11838; O-2990; 153D395; 504M154; A828110; Q412476; F0001-1314; Z1079442080
|
|
CAS | 504-15-4 | |
PubChem CID | 10436 | |
ChEMBL ID | CHEMBL110059 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 124.14 | ALogp: | 1.6 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 9 | QED Weighted: | 0.554 |
Caco-2 Permeability: | -4.578 | MDCK Permeability: | 0.00001410 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.655 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.97 |
30% Bioavailability (F30%): | 0.937 |
Blood-Brain-Barrier Penetration (BBB): | 0.056 | Plasma Protein Binding (PPB): | 57.04% |
Volume Distribution (VD): | 0.775 | Fu: | 38.86% |
CYP1A2-inhibitor: | 0.883 | CYP1A2-substrate: | 0.731 |
CYP2C19-inhibitor: | 0.153 | CYP2C19-substrate: | 0.087 |
CYP2C9-inhibitor: | 0.049 | CYP2C9-substrate: | 0.925 |
CYP2D6-inhibitor: | 0.394 | CYP2D6-substrate: | 0.782 |
CYP3A4-inhibitor: | 0.199 | CYP3A4-substrate: | 0.166 |
Clearance (CL): | 15.676 | Half-life (T1/2): | 0.908 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.18 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.619 | Maximum Recommended Daily Dose: | 0.689 |
Skin Sensitization: | 0.927 | Carcinogencity: | 0.057 |
Eye Corrosion: | 0.978 | Eye Irritation: | 0.99 |
Respiratory Toxicity: | 0.244 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003023 | 0.600 | D07EXH | 0.600 | ||||
ENC003024 | 0.514 | D02UFG | 0.422 | ||||
ENC005631 | 0.514 | D0M8RC | 0.404 | ||||
ENC002445 | 0.479 | D03UOT | 0.314 | ||||
ENC005580 | 0.426 | D06GIP | 0.293 | ||||
ENC000329 | 0.412 | D04XEG | 0.288 | ||||
ENC003305 | 0.400 | D0T7OW | 0.256 | ||||
ENC004713 | 0.393 | D04PHC | 0.255 | ||||
ENC005214 | 0.392 | D07MOX | 0.244 | ||||
ENC004676 | 0.378 | D04EYC | 0.244 |