|
Name |
Diorcinol
|
Molecular Formula | C14H14O3 | |
IUPAC Name* |
3-(3-hydroxy-5-methylphenoxy)-5-methylphenol
|
|
SMILES |
CC1=CC(=CC(=C1)OC2=CC(=CC(=C2)O)C)O
|
|
InChI |
InChI=1S/C14H14O3/c1-9-3-11(15)7-13(5-9)17-14-6-10(2)4-12(16)8-14/h3-8,15-16H,1-2H3
|
|
InChIKey |
SPCJQQBYWVGMQG-UHFFFAOYSA-N
|
|
Synonyms |
Diorcinol; 3,3'-oxybis(5-methylphenol); 3,3'-dihydroxy-5,5'-dimethyldiphenyl ether; CHEBI:64413; 20282-75-1; 3-(3-hydroxy-5-methylphenoxy)-5-methylphenol; Dyorcinol; CHEMBL2332161; DTXSID101318702; BS-1438; 3-(3-hydroxy-5-methyl-phenoxy)-5-methyl-phenol; Q27133269
|
|
CAS | 20282-75-1 | |
PubChem CID | 23396613 | |
ChEMBL ID | CHEMBL2332161 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 230.26 | ALogp: | 3.5 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.811 |
Caco-2 Permeability: | -4.919 | MDCK Permeability: | 0.00001560 |
Pgp-inhibitor: | 0.093 | Pgp-substrate: | 0.016 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.968 |
30% Bioavailability (F30%): | 0.977 |
Blood-Brain-Barrier Penetration (BBB): | 0.039 | Plasma Protein Binding (PPB): | 96.11% |
Volume Distribution (VD): | 0.584 | Fu: | 2.47% |
CYP1A2-inhibitor: | 0.96 | CYP1A2-substrate: | 0.761 |
CYP2C19-inhibitor: | 0.874 | CYP2C19-substrate: | 0.098 |
CYP2C9-inhibitor: | 0.581 | CYP2C9-substrate: | 0.961 |
CYP2D6-inhibitor: | 0.954 | CYP2D6-substrate: | 0.889 |
CYP3A4-inhibitor: | 0.568 | CYP3A4-substrate: | 0.187 |
Clearance (CL): | 13.269 | Half-life (T1/2): | 0.889 |
hERG Blockers: | 0.071 | Human Hepatotoxicity (H-HT): | 0.076 |
Drug-inuced Liver Injury (DILI): | 0.041 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.059 | Maximum Recommended Daily Dose: | 0.957 |
Skin Sensitization: | 0.947 | Carcinogencity: | 0.264 |
Eye Corrosion: | 0.661 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.825 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005402 | 0.603 | D07EXH | 0.315 | ||||
ENC005290 | 0.594 | D0S5CH | 0.314 | ||||
ENC002944 | 0.576 | D02UFG | 0.279 | ||||
ENC000979 | 0.571 | D0M8RC | 0.271 | ||||
ENC004713 | 0.530 | D04XEG | 0.271 | ||||
ENC002964 | 0.529 | D04AIT | 0.265 | ||||
ENC004643 | 0.522 | D0Y7PG | 0.263 | ||||
ENC003317 | 0.514 | D07MGA | 0.256 | ||||
ENC002965 | 0.514 | D00CSQ | 0.237 | ||||
ENC004164 | 0.500 | D03TPR | 0.233 |