|
Name |
α-acetylorcinol
|
Molecular Formula | C9H10O3 | |
IUPAC Name* |
1-(3,5-dihydroxyphenyl)propan-2-one
|
|
SMILES |
CC(=O)Cc1cc(O)cc(O)c1
|
|
InChI |
InChI=1S/C9H10O3/c1-6(10)2-7-3-8(11)5-9(12)4-7/h3-5,11-12H,2H2,1H3
|
|
InChIKey |
RDFDQSKPVOIWGZ-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 166.18 | ALogp: | 1.2 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.703 |
Caco-2 Permeability: | -4.696 | MDCK Permeability: | 0.00001290 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.988 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.834 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.082 | Plasma Protein Binding (PPB): | 47.59% |
Volume Distribution (VD): | 0.835 | Fu: | 57.94% |
CYP1A2-inhibitor: | 0.593 | CYP1A2-substrate: | 0.441 |
CYP2C19-inhibitor: | 0.134 | CYP2C19-substrate: | 0.071 |
CYP2C9-inhibitor: | 0.096 | CYP2C9-substrate: | 0.923 |
CYP2D6-inhibitor: | 0.224 | CYP2D6-substrate: | 0.776 |
CYP3A4-inhibitor: | 0.176 | CYP3A4-substrate: | 0.228 |
Clearance (CL): | 16.13 | Half-life (T1/2): | 0.927 |
hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.339 |
Drug-inuced Liver Injury (DILI): | 0.183 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.057 | Maximum Recommended Daily Dose: | 0.208 |
Skin Sensitization: | 0.87 | Carcinogencity: | 0.025 |
Eye Corrosion: | 0.734 | Eye Irritation: | 0.975 |
Respiratory Toxicity: | 0.045 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003024 | 0.561 | D07EXH | 0.474 | ||||
ENC000353 | 0.514 | D02UFG | 0.385 | ||||
ENC003023 | 0.474 | D0M8RC | 0.370 | ||||
ENC005214 | 0.436 | D0BA6T | 0.315 | ||||
ENC001618 | 0.393 | D0U0OT | 0.309 | ||||
ENC002370 | 0.392 | D08HVR | 0.302 | ||||
ENC000344 | 0.386 | D0P7JZ | 0.298 | ||||
ENC000674 | 0.370 | D04XEG | 0.292 | ||||
ENC002095 | 0.367 | D0Y6KO | 0.279 | ||||
ENC005580 | 0.364 | D0B3QM | 0.278 |