|
Name |
5-Alkenylresorcinol
|
Molecular Formula | C17H31NO10S2 | |
IUPAC Name* |
[3,4-dihydroxy-6-(hydroxymethyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl] N,N-diethylcarbamodithioate
|
|
SMILES |
CCN(CC)C(=S)SC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O
|
|
InChI |
InChI=1S/C17H31NO10S2/c1-3-18(4-2)17(29)30-16-13(25)11(23)14(8(6-20)27-16)28-15-12(24)10(22)9(21)7(5-19)26-15/h7-16,19-25H,3-6H2,1-2H3
|
|
InChIKey |
FFPSVGDYHNQVKG-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | 85096704 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 473.6 | ALogp: | -2.3 |
HBD: | 7 | HBA: | 12 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 230.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 30 | QED Weighted: | 0.514 |
Caco-2 Permeability: | -5.465 | MDCK Permeability: | 0.00032000 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.572 |
Human Intestinal Absorption (HIA): | 0.983 | 20% Bioavailability (F20%): | 0.116 |
30% Bioavailability (F30%): | 0.992 |
Blood-Brain-Barrier Penetration (BBB): | 0.396 | Plasma Protein Binding (PPB): | 13.13% |
Volume Distribution (VD): | 0.444 | Fu: | 65.97% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.04 |
CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.122 |
CYP2C9-inhibitor: | 0 | CYP2C9-substrate: | 0.071 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.106 |
CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.002 |
Clearance (CL): | 1.336 | Half-life (T1/2): | 0.595 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.124 |
Drug-inuced Liver Injury (DILI): | 0.957 | AMES Toxicity: | 0.468 |
Rat Oral Acute Toxicity: | 0.084 | Maximum Recommended Daily Dose: | 0.002 |
Skin Sensitization: | 0.022 | Carcinogencity: | 0.048 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.144 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000353 | 0.600 | D07EXH | 0.600 | ||||
ENC003024 | 0.474 | D02UFG | 0.391 | ||||
ENC005631 | 0.474 | D0M8RC | 0.375 | ||||
ENC005580 | 0.367 | D03UOT | 0.314 | ||||
ENC003305 | 0.346 | D04XEG | 0.269 | ||||
ENC005214 | 0.340 | D0T7OW | 0.256 | ||||
ENC001097 | 0.333 | D07MOX | 0.244 | ||||
ENC002875 | 0.325 | D0C4YC | 0.233 | ||||
ENC004676 | 0.319 | D01WJL | 0.233 | ||||
ENC001542 | 0.319 | D0V9EN | 0.229 |