|
Name |
4-Methylcatechol
|
Molecular Formula | C7H8O2 | |
IUPAC Name* |
4-methylbenzene-1,2-diol
|
|
SMILES |
CC1=CC(=C(C=C1)O)O
|
|
InChI |
InChI=1S/C7H8O2/c1-5-2-3-6(8)7(9)4-5/h2-4,8-9H,1H3
|
|
InChIKey |
ZBCATMYQYDCTIZ-UHFFFAOYSA-N
|
|
Synonyms |
4-Methylcatechol; 452-86-8; 4-methylbenzene-1,2-diol; 3,4-Dihydroxytoluene; Homocatechol; p-Methylcatechol; 4-METHYLPYROCATECHOL; 4-Methyl-1,2-benzenediol; Homopyrocatechol; Toluene-3,4-diol; 1,2-Dihydroxy-4-methylbenzene; p-Methylpyrocatechol; 1,2-Benzenediol, 4-methyl-; 4-Methyl-1,2-dihydroxybenzene; Pyrocatechol, 4-methyl-; 2-Hydroxy-4-methylphenol; CHEBI:17254; NSC 17489; 1-Methyl-3,4-dihydroxybenzene; 12GLI7JGB3; CHEMBL158766; MFCD00002205; NSC-17489; 5-methylcatechol; MCT; CCRIS 3333; EINECS 207-214-5; UNII-12GLI7JGB3; BRN 0636512; 4-Methylcatehol; 4-Metylcatechol; 4-methyl catechol; 4-methyl-catechol; 4-methyl pyrocatechol; 4-methyl-Pyrocatechol; 4k7n; DSSTox_CID_861; bmse000475; Epitope ID:150928; DSSTox_RID_75831; 4-methyl-benzene-1,2-diol; DSSTox_GSID_20861; SCHEMBL12388; 4-Methylcatechol, >=95%; METHYL CATECHOL, 4-; MLS001066329; 4-Methylbenzene-1,2-diol #; 1,2-dihydroxy-5-methylbenzene; DTXSID5020861; 4-methyl-1,2-dihydroxy benzene; HMDB00873; HMS3886M12; AMY25678; NSC17489; Tox21_200632; BDBM50548723; c0126; s5616; ZINC13512210; AKOS000121479; CCG-266087; CS-W013530; DB04120; HY-W012814; NCGC00248773-01; NCGC00258186-01; AC-12438; AS-11944; CAS-452-86-8; SMR000471857; SY012747; DB-051291; FT-0618974; M0413; EN300-21094; C06730; D70562; A872403; DROXIDOPA METABOLITE (3,4-DIHYDROXYTOLUENE); W-106144; Q15303189; F0001-1227; Z104490128
|
|
CAS | 452-86-8 | |
PubChem CID | 9958 | |
ChEMBL ID | CHEMBL158766 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 124.14 | ALogp: | 1.4 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 9 | QED Weighted: | 0.518 |
Caco-2 Permeability: | -4.44 | MDCK Permeability: | 0.00001790 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.06 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.869 |
30% Bioavailability (F30%): | 0.765 |
Blood-Brain-Barrier Penetration (BBB): | 0.066 | Plasma Protein Binding (PPB): | 73.34% |
Volume Distribution (VD): | 0.507 | Fu: | 18.21% |
CYP1A2-inhibitor: | 0.744 | CYP1A2-substrate: | 0.899 |
CYP2C19-inhibitor: | 0.18 | CYP2C19-substrate: | 0.155 |
CYP2C9-inhibitor: | 0.107 | CYP2C9-substrate: | 0.809 |
CYP2D6-inhibitor: | 0.315 | CYP2D6-substrate: | 0.848 |
CYP3A4-inhibitor: | 0.06 | CYP3A4-substrate: | 0.233 |
Clearance (CL): | 19.151 | Half-life (T1/2): | 0.918 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.039 |
Drug-inuced Liver Injury (DILI): | 0.083 | AMES Toxicity: | 0.524 |
Rat Oral Acute Toxicity: | 0.825 | Maximum Recommended Daily Dose: | 0.292 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.637 |
Eye Corrosion: | 0.974 | Eye Irritation: | 0.989 |
Respiratory Toxicity: | 0.854 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000734 | 0.545 | D06GIP | 0.514 | ||||
ENC000172 | 0.545 | D0T7OW | 0.500 | ||||
ENC000002 | 0.514 | D04PHC | 0.475 | ||||
ENC000404 | 0.500 | D07MOX | 0.474 | ||||
ENC002095 | 0.475 | D0V9EN | 0.439 | ||||
ENC000035 | 0.474 | D0BA6T | 0.432 | ||||
ENC001440 | 0.439 | D0U0OT | 0.422 | ||||
ENC000021 | 0.438 | D0I8FI | 0.422 | ||||
ENC000344 | 0.432 | D08HVR | 0.419 | ||||
ENC000127 | 0.419 | D0P7JZ | 0.404 |