![]() |
Name |
3-dehydroxymethylbisdethio-3, 10a-bis (methylthio) gliotoxin
|
Molecular Formula | C14H18N2O3S2 | |
IUPAC Name* |
6-hydroxy-2-methyl-3,10a-bis(methylsulfanyl)-3,5a,6,10-tetrahydropyrazino[1,2-a]indole-1,4-dione
|
|
SMILES |
CSC1C(=O)N2C3C(=CC=CC3O)CC2(SC)C(=O)N1C
|
|
InChI |
InChI=1S/C14H18N2O3S2/c1-15-12(20-2)11(18)16-10-8(5-4-6-9(10)17)7-14(16,21-3)13(15)19/h4-6,9-10,12,17H,7H2,1-3H3/t9-,10-,12+,14+/m0/s1
|
|
InChIKey |
AHKQNTDHDXRTKQ-BQSGVUBFSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 326.44 | ALogp: | 0.7 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 60.9 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.822 |
Caco-2 Permeability: | -4.998 | MDCK Permeability: | 0.00001670 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.389 |
Human Intestinal Absorption (HIA): | 0.306 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.154 | Plasma Protein Binding (PPB): | 49.70% |
Volume Distribution (VD): | 0.73 | Fu: | 57.75% |
CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.112 |
CYP2C19-inhibitor: | 0.177 | CYP2C19-substrate: | 0.888 |
CYP2C9-inhibitor: | 0.278 | CYP2C9-substrate: | 0.152 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.101 |
CYP3A4-inhibitor: | 0.073 | CYP3A4-substrate: | 0.95 |
Clearance (CL): | 2.704 | Half-life (T1/2): | 0.391 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.183 |
Drug-inuced Liver Injury (DILI): | 0.929 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.748 | Maximum Recommended Daily Dose: | 0.748 |
Skin Sensitization: | 0.452 | Carcinogencity: | 0.789 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.543 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005509 | ![]() |
1.000 | D08EOD | ![]() |
0.225 | ||
ENC000993 | ![]() |
0.630 | D0W7RJ | ![]() |
0.215 | ||
ENC003617 | ![]() |
0.500 | D0G6AB | ![]() |
0.202 | ||
ENC000134 | ![]() |
0.438 | D06BYV | ![]() |
0.200 | ||
ENC003438 | ![]() |
0.424 | D0K7LU | ![]() |
0.191 | ||
ENC003595 | ![]() |
0.385 | D0U4VT | ![]() |
0.188 | ||
ENC003035 | ![]() |
0.382 | D0Z8EX | ![]() |
0.188 | ||
ENC004752 | ![]() |
0.343 | D07RGW | ![]() |
0.188 | ||
ENC005510 | ![]() |
0.308 | D03DIG | ![]() |
0.188 | ||
ENC003549 | ![]() |
0.293 | D0R2KF | ![]() |
0.187 |