![]() |
Name |
Peniciadametizine A
|
Molecular Formula | C23H26N2O7S2 | |
IUPAC Name* |
(2R,3R,6'aR,7'R,11'aR)-7'-hydroxy-6,7-dimethoxy-2'-methyl-3,11'a-bis(methylsulfanyl)spiro[3H-1-benzofuran-2,3'-7,11-dihydro-6aH-pyrazino[1,2-b][1,2]benzoxazine]-1',4'-dione
|
|
SMILES |
CN1C(=O)[C@@]2(CC3=CC=C[C@H]([C@@H]3ON2C(=O)[C@@]14[C@@H](C5=C(O4)C(=C(C=C5)OC)OC)SC)O)SC
|
|
InChI |
InChI=1S/C23H26N2O7S2/c1-24-20(27)22(34-5)11-12-7-6-8-14(26)16(12)32-25(22)21(28)23(24)19(33-4)13-9-10-15(29-2)18(30-3)17(13)31-23/h6-10,14,16,19,26H,11H2,1-5H3/t14-,16-,19-,22-,23+/m1/s1
|
|
InChIKey |
UJQYDWBSIBUUKS-KSVPPNQKSA-N
|
|
Synonyms |
Peniciadametizine A
|
|
CAS | NA | |
PubChem CID | 139583684 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 506.6 | ALogp: | 1.5 |
HBD: | 1 | HBA: | 9 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 148.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 34 | QED Weighted: | 0.661 |
Caco-2 Permeability: | -5.014 | MDCK Permeability: | 0.00001540 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.379 |
Human Intestinal Absorption (HIA): | 0.806 | 20% Bioavailability (F20%): | 0.76 |
30% Bioavailability (F30%): | 0.915 |
Blood-Brain-Barrier Penetration (BBB): | 0.621 | Plasma Protein Binding (PPB): | 93.30% |
Volume Distribution (VD): | 1.598 | Fu: | 3.97% |
CYP1A2-inhibitor: | 0.033 | CYP1A2-substrate: | 0.448 |
CYP2C19-inhibitor: | 0.175 | CYP2C19-substrate: | 0.929 |
CYP2C9-inhibitor: | 0.73 | CYP2C9-substrate: | 0.084 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.101 |
CYP3A4-inhibitor: | 0.591 | CYP3A4-substrate: | 0.962 |
Clearance (CL): | 3.798 | Half-life (T1/2): | 0.779 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.886 |
Drug-inuced Liver Injury (DILI): | 0.957 | AMES Toxicity: | 0.471 |
Rat Oral Acute Toxicity: | 0.991 | Maximum Recommended Daily Dose: | 0.919 |
Skin Sensitization: | 0.801 | Carcinogencity: | 0.752 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.063 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003546 | ![]() |
0.684 | D0L1JW | ![]() |
0.299 | ||
ENC003539 | ![]() |
0.684 | D04TDQ | ![]() |
0.297 | ||
ENC003549 | ![]() |
0.558 | D02LZB | ![]() |
0.252 | ||
ENC004277 | ![]() |
0.508 | D09DHY | ![]() |
0.252 | ||
ENC003545 | ![]() |
0.480 | D03DIG | ![]() |
0.246 | ||
ENC003544 | ![]() |
0.480 | D01FFA | ![]() |
0.244 | ||
ENC003540 | ![]() |
0.469 | D06GCK | ![]() |
0.244 | ||
ENC003738 | ![]() |
0.420 | D0D4HN | ![]() |
0.243 | ||
ENC000993 | ![]() |
0.393 | D0C1SF | ![]() |
0.242 | ||
ENC005509 | ![]() |
0.385 | D0F7CS | ![]() |
0.239 |