![]() |
Name |
paecilin O
|
Molecular Formula | C34H36O15 | |
IUPAC Name* |
methyl6-[2-(4-ethoxy-1-hydroxy-2-methyl-4-oxobutyl)-5-hydroxy-2-methoxycarbonyl-4-oxo-3H-chromen-6-yl]-5-hydroxy-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromene-2-carboxylate
|
|
SMILES |
CCOC(=O)CC(C)C(O)C1(C(=O)OC)CC(=O)c2c(ccc(-c3ccc4c(c3O)C(=O)CC(C(=O)OC)(C3OC(=O)CC3C)O4)c2O)O1
|
|
InChI |
InChI=1S/C34H36O15/c1-6-46-23(37)11-15(2)29(41)33(31(42)44-4)13-19(35)25-21(48-33)9-7-17(27(25)39)18-8-10-22-26(28(18)40)20(36)14-34(49-22,32(43)45-5)30-16(3)12-24(38)47-30/h7-10,15-16,29-30,39-41H,6,11-14H2,1-5H3/t15-,16-,29+,30+,33-,34-/m0/s1
|
|
InChIKey |
RZKKRKJNFWVTKM-NHHXLWFISA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 684.65 | ALogp: | 2.4 |
HBD: | 3 | HBA: | 15 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 218.5 | Aromatic Rings: | 5 |
Heavy Atoms: | 49 | QED Weighted: | 0.255 |
Caco-2 Permeability: | -5.267 | MDCK Permeability: | 0.00003020 |
Pgp-inhibitor: | 0.54 | Pgp-substrate: | 0.03 |
Human Intestinal Absorption (HIA): | 0.654 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.907 |
Blood-Brain-Barrier Penetration (BBB): | 0.018 | Plasma Protein Binding (PPB): | 84.29% |
Volume Distribution (VD): | 0.412 | Fu: | 4.97% |
CYP1A2-inhibitor: | 0.032 | CYP1A2-substrate: | 0.511 |
CYP2C19-inhibitor: | 0.152 | CYP2C19-substrate: | 0.127 |
CYP2C9-inhibitor: | 0.591 | CYP2C9-substrate: | 0.729 |
CYP2D6-inhibitor: | 0.039 | CYP2D6-substrate: | 0.176 |
CYP3A4-inhibitor: | 0.885 | CYP3A4-substrate: | 0.595 |
Clearance (CL): | 13.948 | Half-life (T1/2): | 0.127 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.809 |
Drug-inuced Liver Injury (DILI): | 0.972 | AMES Toxicity: | 0.025 |
Rat Oral Acute Toxicity: | 0.859 | Maximum Recommended Daily Dose: | 0.016 |
Skin Sensitization: | 0.009 | Carcinogencity: | 0.121 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.004 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005735 | ![]() |
0.920 | D07IPB | ![]() |
0.284 | ||
ENC005734 | ![]() |
0.884 | D0T5XN | ![]() |
0.281 | ||
ENC005727 | ![]() |
0.814 | D01XWG | ![]() |
0.255 | ||
ENC005729 | ![]() |
0.742 | D07VLY | ![]() |
0.251 | ||
ENC005732 | ![]() |
0.719 | D0C9XJ | ![]() |
0.251 | ||
ENC003347 | ![]() |
0.679 | D01XDL | ![]() |
0.249 | ||
ENC005733 | ![]() |
0.671 | D01UBX | ![]() |
0.248 | ||
ENC005737 | ![]() |
0.648 | D0T8EH | ![]() |
0.240 | ||
ENC005885 | ![]() |
0.633 | D0Q0PR | ![]() |
0.235 | ||
ENC003346 | ![]() |
0.617 | D00HDU | ![]() |
0.226 |