|
Name |
Daldiniaeschsone B
|
Molecular Formula | C32H30O14 | |
IUPAC Name* |
methyl2-[9-hydroxy-8-[9-hydroxy-10a-(2-methoxy-2-oxoethyl)-4-methyl-2,10-dioxo-4,4a-dihydro-3H-pyrano[3,2-b]chromen-8-yl]-4-methyl-2,10-dioxo-4,4a-dihydro-3H-pyrano[3,2-b]chromen-10a-yl]acetate
|
|
SMILES |
COC(=O)CC12OC(=O)CC(C)C1Oc1ccc(-c3ccc4c(c3O)C(=O)C3(CC(=O)OC)OC(=O)CC(C)C3O4)c(O)c1C2=O
|
|
InChI |
InChI=1S/C32H30O14/c1-13-9-19(33)45-31(11-21(35)41-3)27(39)23-17(43-29(13)31)7-5-15(25(23)37)16-6-8-18-24(26(16)38)28(40)32(12-22(36)42-4)30(44-18)14(2)10-20(34)46-32/h5-8,13-14,29-30,37-38H,9-12H2,1-4H3/t13-,14-,29+,30+,31+,32+/m1/s1
|
|
InChIKey |
JZPDIZAUHLRDCE-HJANBRIKSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 638.58 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 14 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 198.3 | Aromatic Rings: | 6 |
Heavy Atoms: | 46 | QED Weighted: | 0.357 |
Caco-2 Permeability: | -5.223 | MDCK Permeability: | 0.00004120 |
Pgp-inhibitor: | 0.496 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.767 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.776 |
Blood-Brain-Barrier Penetration (BBB): | 0.015 | Plasma Protein Binding (PPB): | 80.09% |
Volume Distribution (VD): | 0.288 | Fu: | 8.49% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.323 |
CYP2C19-inhibitor: | 0.307 | CYP2C19-substrate: | 0.208 |
CYP2C9-inhibitor: | 0.54 | CYP2C9-substrate: | 0.79 |
CYP2D6-inhibitor: | 0.041 | CYP2D6-substrate: | 0.188 |
CYP3A4-inhibitor: | 0.811 | CYP3A4-substrate: | 0.562 |
Clearance (CL): | 13.315 | Half-life (T1/2): | 0.205 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.736 |
Drug-inuced Liver Injury (DILI): | 0.931 | AMES Toxicity: | 0.025 |
Rat Oral Acute Toxicity: | 0.921 | Maximum Recommended Daily Dose: | 0.033 |
Skin Sensitization: | 0.019 | Carcinogencity: | 0.058 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.008 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005733 | 0.595 | D0T5XN | 0.265 | ||||
ENC005885 | 0.521 | D01XWG | 0.258 | ||||
ENC005731 | 0.500 | D07IPB | 0.257 | ||||
ENC002448 | 0.500 | D07VLY | 0.254 | ||||
ENC005735 | 0.488 | D0C9XJ | 0.254 | ||||
ENC005736 | 0.480 | D01XDL | 0.251 | ||||
ENC005734 | 0.480 | D0F7CS | 0.246 | ||||
ENC003348 | 0.476 | D01UBX | 0.245 | ||||
ENC000954 | 0.453 | D0T8EH | 0.236 | ||||
ENC000710 | 0.453 | D0Q0PR | 0.231 |