![]() |
Name |
acuminatum C
|
Molecular Formula | C44H71N7O11 | |
IUPAC Name* |
3-[22-dodecan-2-yl-18-(1-hydroxyethyl)-6-[(4-hydroxyphenyl)methyl]-12,15-dimethyl-2,5,8,11,14,17,20-heptaoxo-3-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-9-yl]propanamide
|
|
SMILES |
CCCCCCCCCCC(C)C1CC(=O)NC(C(C)O)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCC(N)=O)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(C(C)C)C(=O)O1
|
|
InChI |
InChI=1S/C44H71N7O11/c1-8-9-10-11-12-13-14-15-16-26(4)34-24-36(55)50-38(29(7)52)43(60)47-27(5)39(56)46-28(6)40(57)48-32(21-22-35(45)54)41(58)49-33(23-30-17-19-31(53)20-18-30)42(59)51-37(25(2)3)44(61)62-34/h17-20,25-29,32-34,37-38,52-53H,8-16,21-24H2,1-7H3,(H2,45,54)(H,46,56)(H,47,60)(H,48,57)(H,49,58)(H,50,55)(H,51,59)/t26-,27+,28-,29-,32+,33-,34+,37+,38-/m1/s1
|
|
InChIKey |
BRLXWEGCLDQJEL-OOQNKUTCSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 874.09 | ALogp: | 1.7 |
HBD: | 9 | HBA: | 11 |
Rotatable Bonds: | 17 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 284.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 62 | QED Weighted: | 0.081 |
Caco-2 Permeability: | -5.738 | MDCK Permeability: | 0.00003070 |
Pgp-inhibitor: | 0.986 | Pgp-substrate: | 0.993 |
Human Intestinal Absorption (HIA): | 0.793 | 20% Bioavailability (F20%): | 0.98 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.008 | Plasma Protein Binding (PPB): | 89.00% |
Volume Distribution (VD): | 0.396 | Fu: | 5.50% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.018 |
CYP2C19-inhibitor: | 0.053 | CYP2C19-substrate: | 0.045 |
CYP2C9-inhibitor: | 0.205 | CYP2C9-substrate: | 0.067 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.065 |
CYP3A4-inhibitor: | 0.706 | CYP3A4-substrate: | 0.114 |
Clearance (CL): | 2.605 | Half-life (T1/2): | 0.595 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.931 |
Drug-inuced Liver Injury (DILI): | 0.03 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.2 | Maximum Recommended Daily Dose: | 0.104 |
Skin Sensitization: | 0.031 | Carcinogencity: | 0.007 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
Respiratory Toxicity: | 0.002 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005273 | ![]() |
0.915 | D02SBQ | ![]() |
0.419 | ||
ENC003950 | ![]() |
0.859 | D0M3FJ | ![]() |
0.409 | ||
ENC005271 | ![]() |
0.842 | D08FJL | ![]() |
0.381 | ||
ENC005272 | ![]() |
0.833 | D0D8XY | ![]() |
0.377 | ||
ENC005274 | ![]() |
0.832 | D00ZCN | ![]() |
0.370 | ||
ENC005276 | ![]() |
0.781 | D0M2YE | ![]() |
0.368 | ||
ENC003684 | ![]() |
0.634 | D09OOV | ![]() |
0.363 | ||
ENC003716 | ![]() |
0.598 | D09PZZ | ![]() |
0.355 | ||
ENC002514 | ![]() |
0.541 | D0J7XL | ![]() |
0.349 | ||
ENC001506 | ![]() |
0.528 | D06TFE | ![]() |
0.345 |