|
Name |
acuminatum F
|
Molecular Formula | C45H73N7O12 | |
IUPAC Name* |
3-[3-butan-2-yl-6-[(3,4-dihydroxyphenyl)methyl]-23-dodecan-2-yl-18-(1-hydroxyethyl)-12,15-dimethyl-2,5,8,11,14,17,20-heptaoxo-1-oxa-4,7,10,13,16,19-hexazacyclotricos-9-yl]propanamide
|
|
SMILES |
CCCCCCCCCCC(C)C1CC(=O)NC(C(C)O)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCC(N)=O)C(=O)NC(Cc2ccc(O)c(O)c2)C(=O)NC(C(C)CC)C(=O)O1
|
|
InChI |
InChI=1S/C45H73N7O12/c1-8-10-11-12-13-14-15-16-17-26(4)35-24-37(57)51-39(29(7)53)44(62)48-27(5)40(58)47-28(6)41(59)49-31(19-21-36(46)56)42(60)50-32(22-30-18-20-33(54)34(55)23-30)43(61)52-38(25(3)9-2)45(63)64-35/h18,20,23,25-29,31-32,35,38-39,53-55H,8-17,19,21-22,24H2,1-7H3,(H2,46,56)(H,47,58)(H,48,62)(H,49,59)(H,50,60)(H,51,57)(H,52,61)/t25-,26+,27-,28+,29+,31-,32+,35-,38-,39+/m0/s1
|
|
InChIKey |
OBDSYMWOEATGHN-WFOXBVGYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 904.12 | ALogp: | 1.8 |
HBD: | 10 | HBA: | 12 |
Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 304.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 64 | QED Weighted: | 0.058 |
Caco-2 Permeability: | -5.784 | MDCK Permeability: | 0.00001850 |
Pgp-inhibitor: | 0.981 | Pgp-substrate: | 0.996 |
Human Intestinal Absorption (HIA): | 0.879 | 20% Bioavailability (F20%): | 0.983 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.011 | Plasma Protein Binding (PPB): | 92.73% |
Volume Distribution (VD): | 0.36 | Fu: | 4.66% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.021 |
CYP2C19-inhibitor: | 0.047 | CYP2C19-substrate: | 0.044 |
CYP2C9-inhibitor: | 0.283 | CYP2C9-substrate: | 0.067 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.061 |
CYP3A4-inhibitor: | 0.786 | CYP3A4-substrate: | 0.073 |
Clearance (CL): | 2.663 | Half-life (T1/2): | 0.692 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.872 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.065 | Maximum Recommended Daily Dose: | 0.275 |
Skin Sensitization: | 0.034 | Carcinogencity: | 0.006 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
Respiratory Toxicity: | 0.003 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003950 | 0.856 | D02SBQ | 0.372 | ||||
ENC005275 | 0.833 | D0M3FJ | 0.369 | ||||
ENC005273 | 0.801 | D0D8XY | 0.365 | ||||
ENC005271 | 0.800 | D09OOV | 0.357 | ||||
ENC005274 | 0.782 | D00ZCN | 0.344 | ||||
ENC005276 | 0.733 | D08FJL | 0.343 | ||||
ENC003684 | 0.557 | D0M1IO | 0.335 | ||||
ENC003716 | 0.524 | D05HPI | 0.335 | ||||
ENC002057 | 0.493 | D0K7NQ | 0.331 | ||||
ENC002514 | 0.490 | D02XIY | 0.329 |