|
Name |
acuminatum A
|
Molecular Formula | C45H73N7O11 | |
IUPAC Name* |
3-[22-dodecan-2-yl-19-(1-hydroxyethyl)-6-[(4-hydroxyphenyl)methyl]-12,15-dimethyl-3-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1-oxa-4,7,10,13,16,18-hexazacyclodocos-9-yl]propanamide
|
|
SMILES |
CCCCCCCCCCC(C)C1CC(=O)NC(C(C)O)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCC(N)=O)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(CC(C)C)C(=O)O1
|
|
InChI |
InChI=1S/C45H73N7O11/c1-8-9-10-11-12-13-14-15-16-27(4)36-25-38(56)52-39(30(7)53)44(61)48-28(5)40(57)47-29(6)41(58)49-33(21-22-37(46)55)42(59)50-34(24-31-17-19-32(54)20-18-31)43(60)51-35(23-26(2)3)45(62)63-36/h17-20,26-30,33-36,39,53-54H,8-16,21-25H2,1-7H3,(H2,46,55)(H,47,57)(H,48,61)(H,49,58)(H,50,59)(H,51,60)(H,52,56)/t27-,28+,29-,30-,33+,34-,35+,36+,39-/m1/s1
|
|
InChIKey |
SFSVEGYBMXFUOI-GLUHNORLSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 888.12 | ALogp: | 2.1 |
HBD: | 9 | HBA: | 11 |
Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 284.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 63 | QED Weighted: | 0.076 |
Caco-2 Permeability: | -5.683 | MDCK Permeability: | 0.00005520 |
Pgp-inhibitor: | 0.985 | Pgp-substrate: | 0.988 |
Human Intestinal Absorption (HIA): | 0.711 | 20% Bioavailability (F20%): | 0.977 |
30% Bioavailability (F30%): | 0.991 |
Blood-Brain-Barrier Penetration (BBB): | 0.007 | Plasma Protein Binding (PPB): | 89.63% |
Volume Distribution (VD): | 0.394 | Fu: | 4.78% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.02 |
CYP2C19-inhibitor: | 0.071 | CYP2C19-substrate: | 0.045 |
CYP2C9-inhibitor: | 0.314 | CYP2C9-substrate: | 0.118 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.074 |
CYP3A4-inhibitor: | 0.781 | CYP3A4-substrate: | 0.093 |
Clearance (CL): | 2.905 | Half-life (T1/2): | 0.527 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.933 |
Drug-inuced Liver Injury (DILI): | 0.028 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.217 | Maximum Recommended Daily Dose: | 0.257 |
Skin Sensitization: | 0.039 | Carcinogencity: | 0.009 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
Respiratory Toxicity: | 0.002 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005275 | 0.915 | D0M3FJ | 0.415 | ||||
ENC005274 | 0.829 | D02SBQ | 0.408 | ||||
ENC005271 | 0.828 | D09OOV | 0.387 | ||||
ENC003950 | 0.825 | D08FJL | 0.377 | ||||
ENC005272 | 0.801 | D0D8XY | 0.363 | ||||
ENC005276 | 0.750 | D09PZZ | 0.361 | ||||
ENC003684 | 0.604 | D00ZCN | 0.361 | ||||
ENC003716 | 0.569 | D0M2YE | 0.359 | ||||
ENC002514 | 0.557 | D0K7NQ | 0.357 | ||||
ENC001506 | 0.534 | D0J7XL | 0.355 |