![]() |
Name |
acuminatum B
|
Molecular Formula | C45H75N7O11 | |
IUPAC Name* |
3-[3-butan-2-yl-22-dodecan-2-yl-2-hydroxy-18-(1-hydroxyethyl)-6-[(4-hydroxyphenyl)methyl]-12,15-dimethyl-5,8,11,14,17,20-hexaoxo-1-oxa-4,7,10,13,16,19-hexazacyclodocos-9-yl]propanamide
|
|
SMILES |
CCCCCCCCCCC(C)C1CC(=O)NC(C(C)O)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCC(N)=O)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(C(C)CC)C(O)O1
|
|
InChI |
InChI=1S/C45H75N7O11/c1-8-10-11-12-13-14-15-16-17-27(4)35-25-37(56)51-39(30(7)53)44(61)48-28(5)40(57)47-29(6)41(58)49-33(22-23-36(46)55)42(59)50-34(24-31-18-20-32(54)21-19-31)43(60)52-38(26(3)9-2)45(62)63-35/h18-21,26-30,33-35,38-39,45,53-54,62H,8-17,22-25H2,1-7H3,(H2,46,55)(H,47,57)(H,48,61)(H,49,58)(H,50,59)(H,51,56)(H,52,60)/t26-,27+,28-,29+,30+,33-,34+,35-,38-,39+,45?/m0/s1
|
|
InChIKey |
OVHWQJHLBINYHD-NZNIQKMVSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 890.13 | ALogp: | 1.8 |
HBD: | 10 | HBA: | 11 |
Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 287.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 63 | QED Weighted: | 0.096 |
Caco-2 Permeability: | -5.78 | MDCK Permeability: | 0.00003300 |
Pgp-inhibitor: | 0.972 | Pgp-substrate: | 0.937 |
Human Intestinal Absorption (HIA): | 0.887 | 20% Bioavailability (F20%): | 0.98 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.008 | Plasma Protein Binding (PPB): | 94.87% |
Volume Distribution (VD): | 0.487 | Fu: | 2.64% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.029 |
CYP2C19-inhibitor: | 0.053 | CYP2C19-substrate: | 0.055 |
CYP2C9-inhibitor: | 0.21 | CYP2C9-substrate: | 0.05 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.065 |
CYP3A4-inhibitor: | 0.712 | CYP3A4-substrate: | 0.142 |
Clearance (CL): | 2.16 | Half-life (T1/2): | 0.622 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.879 |
Drug-inuced Liver Injury (DILI): | 0.022 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.257 | Maximum Recommended Daily Dose: | 0.18 |
Skin Sensitization: | 0.033 | Carcinogencity: | 0.005 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.002 |
Respiratory Toxicity: | 0.004 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005275 | ![]() |
0.832 | D0M3FJ | ![]() |
0.404 | ||
ENC005273 | ![]() |
0.829 | D02SBQ | ![]() |
0.402 | ||
ENC003950 | ![]() |
0.797 | D00ZCN | ![]() |
0.380 | ||
ENC005271 | ![]() |
0.789 | D08FJL | ![]() |
0.377 | ||
ENC005272 | ![]() |
0.782 | D0D8XY | ![]() |
0.373 | ||
ENC005276 | ![]() |
0.723 | D09OOV | ![]() |
0.355 | ||
ENC003684 | ![]() |
0.589 | D09PZZ | ![]() |
0.347 | ||
ENC003716 | ![]() |
0.555 | D0M2YE | ![]() |
0.340 | ||
ENC001506 | ![]() |
0.515 | D02XIY | ![]() |
0.336 | ||
ENC002514 | ![]() |
0.480 | D0N4OW | ![]() |
0.326 |