![]() |
Name |
Meleagrin G
|
Molecular Formula | C30H32N6O9 | |
IUPAC Name* |
4-(1-carboxyethylamino)-3-[4-[[11-hydroxy-2-methoxy-9-(2-methylbut-3-en-2-yl)-12,16-dioxo-2,13,15-triazatetracyclo[7.7.0.01,13.03,8]hexadeca-3,5,7,10-tetraen-14-ylidene]methyl]imidazol-1-yl]-4-oxobutanoicacid
|
|
SMILES |
C=CC(C)(C)C12C=C(O)C(=O)N3C(=Cc4cn(C(CC(=O)O)C(=O)NC(C)C(=O)O)cn4)C(=O)NC31N(OC)c1ccccc12
|
|
InChI |
InChI=1S/C30H32N6O9/c1-6-28(3,4)29-13-22(37)26(42)35-21(25(41)33-30(29,35)36(45-5)19-10-8-7-9-18(19)29)11-17-14-34(15-31-17)20(12-23(38)39)24(40)32-16(2)27(43)44/h6-11,13-16,20,37H,1,12H2,2-5H3,(H,32,40)(H,33,41)(H,38,39)(H,43,44)/b21-11+/t16-,20-,29-,30-/m0/s1
|
|
InChIKey |
NBWMXBPXYCNZOP-SJBAXZNZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 620.62 | ALogp: | 1.4 |
HBD: | 5 | HBA: | 10 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 203.6 | Aromatic Rings: | 5 |
Heavy Atoms: | 45 | QED Weighted: | 0.192 |
Caco-2 Permeability: | -6.083 | MDCK Permeability: | 0.00000840 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.511 |
Human Intestinal Absorption (HIA): | 0.95 | 20% Bioavailability (F20%): | 0.982 |
30% Bioavailability (F30%): | 0.957 |
Blood-Brain-Barrier Penetration (BBB): | 0.043 | Plasma Protein Binding (PPB): | 52.78% |
Volume Distribution (VD): | 0.133 | Fu: | 48.24% |
CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.17 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.047 |
CYP2C9-inhibitor: | 0.032 | CYP2C9-substrate: | 0.979 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.092 |
CYP3A4-inhibitor: | 0.079 | CYP3A4-substrate: | 0.901 |
Clearance (CL): | 2.172 | Half-life (T1/2): | 0.453 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.085 |
Drug-inuced Liver Injury (DILI): | 0.994 | AMES Toxicity: | 0.072 |
Rat Oral Acute Toxicity: | 0.102 | Maximum Recommended Daily Dose: | 0.024 |
Skin Sensitization: | 0.566 | Carcinogencity: | 0.538 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.022 |
Respiratory Toxicity: | 0.837 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004496 | ![]() |
0.900 | D04ZAH | ![]() |
0.243 | ||
ENC004495 | ![]() |
0.900 | D0R5OS | ![]() |
0.235 | ||
ENC004492 | ![]() |
0.611 | D0O5LU | ![]() |
0.235 | ||
ENC002908 | ![]() |
0.507 | D00HDU | ![]() |
0.233 | ||
ENC004497 | ![]() |
0.506 | D02TBI | ![]() |
0.231 | ||
ENC004493 | ![]() |
0.435 | D01MGA | ![]() |
0.230 | ||
ENC004263 | ![]() |
0.333 | D02NEH | ![]() |
0.230 | ||
ENC004262 | ![]() |
0.327 | D0PA2N | ![]() |
0.228 | ||
ENC005251 | ![]() |
0.293 | D01KKQ | ![]() |
0.228 | ||
ENC003221 | ![]() |
0.292 | D08GHB | ![]() |
0.228 |