![]() |
Name |
4-Epi-seco-shornephine a methyl ester
|
Molecular Formula | C26H30N2O6 | |
IUPAC Name* |
methyl (2R)-3-[(3R)-7-hydroxy-3-(2-methylbut-3-en-2-yl)-2-oxo-1H-indol-3-yl]-2-[[(2S)-2-hydroxy-3-phenylpropanoyl]amino]propanoate
|
|
SMILES |
CC(C)(C=C)[C@@]1(C2=C(C(=CC=C2)O)NC1=O)C[C@H](C(=O)OC)NC(=O)[C@H](CC3=CC=CC=C3)O
|
|
InChI |
InChI=1S/C26H30N2O6/c1-5-25(2,3)26(17-12-9-13-19(29)21(17)28-24(26)33)15-18(23(32)34-4)27-22(31)20(30)14-16-10-7-6-8-11-16/h5-13,18,20,29-30H,1,14-15H2,2-4H3,(H,27,31)(H,28,33)/t18-,20+,26-/m1/s1
|
|
InChIKey |
NLJQJJGYCFVOFQ-ZTEVPRNISA-N
|
|
Synonyms |
4-epi-seco-shornephine a methyl ester
|
|
CAS | NA | |
PubChem CID | 156580566 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 466.5 | ALogp: | 3.2 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 125.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 34 | QED Weighted: | 0.256 |
Caco-2 Permeability: | -4.793 | MDCK Permeability: | 0.00002540 |
Pgp-inhibitor: | 0.356 | Pgp-substrate: | 0.134 |
Human Intestinal Absorption (HIA): | 0.038 | 20% Bioavailability (F20%): | 0.023 |
30% Bioavailability (F30%): | 0.011 |
Blood-Brain-Barrier Penetration (BBB): | 0.163 | Plasma Protein Binding (PPB): | 90.93% |
Volume Distribution (VD): | 0.423 | Fu: | 15.39% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.24 |
CYP2C19-inhibitor: | 0.294 | CYP2C19-substrate: | 0.792 |
CYP2C9-inhibitor: | 0.735 | CYP2C9-substrate: | 0.931 |
CYP2D6-inhibitor: | 0.166 | CYP2D6-substrate: | 0.223 |
CYP3A4-inhibitor: | 0.927 | CYP3A4-substrate: | 0.866 |
Clearance (CL): | 1.878 | Half-life (T1/2): | 0.686 |
hERG Blockers: | 0.073 | Human Hepatotoxicity (H-HT): | 0.246 |
Drug-inuced Liver Injury (DILI): | 0.24 | AMES Toxicity: | 0.113 |
Rat Oral Acute Toxicity: | 0.624 | Maximum Recommended Daily Dose: | 0.217 |
Skin Sensitization: | 0.05 | Carcinogencity: | 0.041 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.059 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004263 | ![]() |
0.867 | D0RA5Q | ![]() |
0.345 | ||
ENC001985 | ![]() |
0.422 | D0D7KC | ![]() |
0.333 | ||
ENC004235 | ![]() |
0.383 | D02NEH | ![]() |
0.324 | ||
ENC003221 | ![]() |
0.346 | D0A8XN | ![]() |
0.322 | ||
ENC003246 | ![]() |
0.346 | D0SH3I | ![]() |
0.315 | ||
ENC004496 | ![]() |
0.346 | D0BV3J | ![]() |
0.315 | ||
ENC004495 | ![]() |
0.346 | D05OFX | ![]() |
0.312 | ||
ENC004497 | ![]() |
0.337 | D0U3EC | ![]() |
0.312 | ||
ENC005251 | ![]() |
0.336 | D0T0KA | ![]() |
0.310 | ||
ENC002862 | ![]() |
0.333 | D0L0SW | ![]() |
0.309 |