![]() |
Name |
Meleagrin H
|
Molecular Formula | C34H35N5O6 | |
IUPAC Name* |
3-[4-[[11-hydroxy-2-methoxy-9-(2-methylbut-3-en-2-yl)-12,16-dioxo-2,17-diazatetracyclo[7.7.0.01,13.03,8]hexadeca-3,5,7,10-tetraen-14-ylidene]methyl]imidazol-1-yl]-N-(2-hydroxyphenyl)butanamide
|
|
SMILES |
C=CC(C)(C)C12C=C(O)C(=O)C3C(=Cc4cn(C(C)CC(=O)Nc5ccccc5O)cn4)C(=O)NC31N(OC)c1ccccc12
|
|
InChI |
InChI=1S/C34H35N5O6/c1-6-32(3,4)33-17-27(41)30(43)29-22(31(44)37-34(29,33)39(45-5)25-13-9-7-11-23(25)33)16-21-18-38(19-35-21)20(2)15-28(42)36-24-12-8-10-14-26(24)40/h6-14,16-20,29,40-41H,1,15H2,2-5H3,(H,36,42)(H,37,44)/b22-16+/t20?,29?,33-,34-/m0/s1
|
|
InChIKey |
RIXDLMDQXYWRFJ-OTMRKFMSSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 609.68 | ALogp: | 4.6 |
HBD: | 4 | HBA: | 9 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 146.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 45 | QED Weighted: | 0.158 |
Caco-2 Permeability: | -5.067 | MDCK Permeability: | 0.00003160 |
Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.024 |
Human Intestinal Absorption (HIA): | 0.037 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.671 |
Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 95.83% |
Volume Distribution (VD): | 0.47 | Fu: | 4.40% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.467 |
CYP2C19-inhibitor: | 0.587 | CYP2C19-substrate: | 0.516 |
CYP2C9-inhibitor: | 0.97 | CYP2C9-substrate: | 0.897 |
CYP2D6-inhibitor: | 0.244 | CYP2D6-substrate: | 0.091 |
CYP3A4-inhibitor: | 0.964 | CYP3A4-substrate: | 0.949 |
Clearance (CL): | 7.323 | Half-life (T1/2): | 0.182 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.128 |
Drug-inuced Liver Injury (DILI): | 0.981 | AMES Toxicity: | 0.353 |
Rat Oral Acute Toxicity: | 0.905 | Maximum Recommended Daily Dose: | 0.906 |
Skin Sensitization: | 0.705 | Carcinogencity: | 0.929 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.559 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004494 | ![]() |
0.506 | D0Q5UQ | ![]() |
0.258 | ||
ENC004496 | ![]() |
0.497 | D02NEH | ![]() |
0.253 | ||
ENC004495 | ![]() |
0.497 | D0E3OF | ![]() |
0.250 | ||
ENC004492 | ![]() |
0.446 | D0J5YC | ![]() |
0.250 | ||
ENC004493 | ![]() |
0.436 | D0W7WC | ![]() |
0.245 | ||
ENC002908 | ![]() |
0.391 | D0N2SR | ![]() |
0.244 | ||
ENC005251 | ![]() |
0.361 | D0X5ZI | ![]() |
0.244 | ||
ENC003221 | ![]() |
0.344 | D0P6ZH | ![]() |
0.244 | ||
ENC003246 | ![]() |
0.344 | D0G9YH | ![]() |
0.242 | ||
ENC006112 | ![]() |
0.342 | D09ZXR | ![]() |
0.242 |