![]() |
Name |
Methylmeleagrin G
|
Molecular Formula | C31H34N6O9 | |
IUPAC Name* |
3-[4-[[11-hydroxy-2-methoxy-9-(2-methylbut-3-en-2-yl)-12,16-dioxo-2,13,15-triazatetracyclo[7.7.0.01,13.03,8]hexadeca-3,5,7,10-tetraen-14-ylidene]methyl]imidazol-1-yl]-4-[(1-methoxy-1-oxopropan-2-yl)amino]-4-oxobutanoicacid
|
|
SMILES |
C=CC(C)(C)C12C=C(O)C(=O)N3C(=Cc4cn(C(CC(=O)O)C(=O)NC(C)C(=O)OC)cn4)C(=O)NC31N(OC)c1ccccc12
|
|
InChI |
InChI=1S/C31H34N6O9/c1-7-29(3,4)30-14-23(38)27(43)36-22(26(42)34-31(30,36)37(46-6)20-11-9-8-10-19(20)30)12-18-15-35(16-32-18)21(13-24(39)40)25(41)33-17(2)28(44)45-5/h7-12,14-17,21,38H,1,13H2,2-6H3,(H,33,41)(H,34,42)(H,39,40)/b22-12+/t17-,21-,30-,31-/m0/s1
|
|
InChIKey |
BVMHSPRCXOGNDX-LAPWJJNHSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 634.65 | ALogp: | 1.5 |
HBD: | 4 | HBA: | 11 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 192.6 | Aromatic Rings: | 5 |
Heavy Atoms: | 46 | QED Weighted: | 0.17 |
Caco-2 Permeability: | -5.757 | MDCK Permeability: | 0.00001550 |
Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.417 |
Human Intestinal Absorption (HIA): | 0.96 | 20% Bioavailability (F20%): | 0.997 |
30% Bioavailability (F30%): | 0.99 |
Blood-Brain-Barrier Penetration (BBB): | 0.047 | Plasma Protein Binding (PPB): | 41.41% |
Volume Distribution (VD): | 0.154 | Fu: | 64.90% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.305 |
CYP2C19-inhibitor: | 0.065 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.175 | CYP2C9-substrate: | 0.793 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.094 |
CYP3A4-inhibitor: | 0.781 | CYP3A4-substrate: | 0.949 |
Clearance (CL): | 5.33 | Half-life (T1/2): | 0.318 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.195 |
Drug-inuced Liver Injury (DILI): | 0.988 | AMES Toxicity: | 0.228 |
Rat Oral Acute Toxicity: | 0.129 | Maximum Recommended Daily Dose: | 0.041 |
Skin Sensitization: | 0.549 | Carcinogencity: | 0.497 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.825 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
![]() |
D00HDU | ![]() |
0.250 | ||||
![]() |
D04ZAH | ![]() |
0.239 | ||||
![]() |
D04KAQ | ![]() |
0.234 | ||||
![]() |
D0R5OS | ![]() |
0.231 | ||||
![]() |
D07IQS | ![]() |
0.227 | ||||
![]() |
D01MGA | ![]() |
0.226 | ||||
![]() |
D02NEH | ![]() |
0.226 | ||||
![]() |
D0D4YZ | ![]() |
0.225 | ||||
![]() |
D0PA2N | ![]() |
0.224 | ||||
![]() |
D09ZXR | ![]() |
0.223 |