![]() |
Name |
(3S,5R,8S,9R,10S,13R,14R)-3-acetyloxy-17-hydroxy-14-methoxycarbonyl-4,4,8,12,13,16-hexamethyl-15-oxo-2,3,5,6,7,9-hexahydro-1H-cyclopenta[a]phenanthrene-10-carboxylic acid
|
Molecular Formula | C28H38O8 | |
IUPAC Name* |
(3S,5R,8S,9R,10S,13R,14R)-3-acetyloxy-17-hydroxy-14-methoxycarbonyl-4,4,8,12,13,16-hexamethyl-15-oxo-2,3,5,6,7,9-hexahydro-1H-cyclopenta[a]phenanthrene-10-carboxylic acid
|
|
SMILES |
CC1=C[C@@H]2[C@](CC[C@H]3[C@]2(CC[C@@H](C3(C)C)OC(=O)C)C(=O)O)([C@]4([C@@]1(C(=C(C4=O)C)O)C)C(=O)OC)C
|
|
InChI |
InChI=1S/C28H38O8/c1-14-13-18-25(6,28(23(34)35-8)21(31)15(2)20(30)26(14,28)7)11-9-17-24(4,5)19(36-16(3)29)10-12-27(17,18)22(32)33/h13,17-19,30H,9-12H2,1-8H3,(H,32,33)/t17-,18-,19+,25+,26+,27+,28-/m1/s1
|
|
InChIKey |
IIAVWNADOABJOD-UOHNCGBGSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | 146683323 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 502.6 | ALogp: | 3.9 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 127.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 36 | QED Weighted: | 0.317 |
Caco-2 Permeability: | -5.491 | MDCK Permeability: | 0.00003480 |
Pgp-inhibitor: | 0.268 | Pgp-substrate: | 0.183 |
Human Intestinal Absorption (HIA): | 0.043 | 20% Bioavailability (F20%): | 0.674 |
30% Bioavailability (F30%): | 0.942 |
Blood-Brain-Barrier Penetration (BBB): | 0.237 | Plasma Protein Binding (PPB): | 69.77% |
Volume Distribution (VD): | 0.385 | Fu: | 25.29% |
CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.906 |
CYP2C19-inhibitor: | 0.011 | CYP2C19-substrate: | 0.872 |
CYP2C9-inhibitor: | 0.026 | CYP2C9-substrate: | 0.174 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.091 |
CYP3A4-inhibitor: | 0.143 | CYP3A4-substrate: | 0.668 |
Clearance (CL): | 2.149 | Half-life (T1/2): | 0.523 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.18 |
Drug-inuced Liver Injury (DILI): | 0.663 | AMES Toxicity: | 0.045 |
Rat Oral Acute Toxicity: | 0.23 | Maximum Recommended Daily Dose: | 0.033 |
Skin Sensitization: | 0.019 | Carcinogencity: | 0.163 |
Eye Corrosion: | 0.99 | Eye Irritation: | 0.298 |
Respiratory Toxicity: | 0.973 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001949 | ![]() |
0.812 | D0H2MO | ![]() |
0.286 | ||
ENC002012 | ![]() |
0.806 | D0V2JK | ![]() |
0.282 | ||
ENC003138 | ![]() |
0.658 | D0X7XG | ![]() |
0.278 | ||
ENC005963 | ![]() |
0.621 | D04GJN | ![]() |
0.276 | ||
ENC002033 | ![]() |
0.620 | D08BDT | ![]() |
0.272 | ||
ENC003457 | ![]() |
0.617 | D0X4RS | ![]() |
0.272 | ||
ENC005965 | ![]() |
0.607 | D02CNR | ![]() |
0.257 | ||
ENC005964 | ![]() |
0.538 | D01ZOG | ![]() |
0.257 | ||
ENC001980 | ![]() |
0.366 | D03MTN | ![]() |
0.257 | ||
ENC001833 | ![]() |
0.338 | D06AEO | ![]() |
0.250 |