![]() |
Name |
10-demethylated andrastone A
|
Molecular Formula | C27H38O7 | |
IUPAC Name* |
methyl3-acetyloxy-16-hydroxy-4,4,8,12,13,16-hexamethyl-15,17-dioxo-2,3,5,6,7,9,10,14-octahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate
|
|
SMILES |
COC(=O)C12C(=O)C(C)(O)C(=O)C1(C)C(C)=CC1C3CCC(OC(C)=O)C(C)(C)C3CCC12C
|
|
InChI |
InChI=1S/C27H38O7/c1-14-13-18-16-9-10-19(34-15(2)28)23(3,4)17(16)11-12-24(18,5)27(22(31)33-8)21(30)26(7,32)20(29)25(14,27)6/h13,16-19,32H,9-12H2,1-8H3/t16-,17+,18+,19+,24+,25+,26-,27-/m1/s1
|
|
InChIKey |
ULAPLQHHFZACNB-WSCCMGPLSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 474.59 | ALogp: | 3.4 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 34 | QED Weighted: | 0.364 |
Caco-2 Permeability: | -5.166 | MDCK Permeability: | 0.00001650 |
Pgp-inhibitor: | 0.99 | Pgp-substrate: | 0.011 |
Human Intestinal Absorption (HIA): | 0.051 | 20% Bioavailability (F20%): | 0.484 |
30% Bioavailability (F30%): | 0.893 |
Blood-Brain-Barrier Penetration (BBB): | 0.919 | Plasma Protein Binding (PPB): | 87.45% |
Volume Distribution (VD): | 1.113 | Fu: | 21.45% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.889 |
CYP2C19-inhibitor: | 0.076 | CYP2C19-substrate: | 0.94 |
CYP2C9-inhibitor: | 0.111 | CYP2C9-substrate: | 0.109 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.087 |
CYP3A4-inhibitor: | 0.866 | CYP3A4-substrate: | 0.945 |
Clearance (CL): | 3.931 | Half-life (T1/2): | 0.023 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.342 |
Drug-inuced Liver Injury (DILI): | 0.869 | AMES Toxicity: | 0.37 |
Rat Oral Acute Toxicity: | 0.432 | Maximum Recommended Daily Dose: | 0.047 |
Skin Sensitization: | 0.005 | Carcinogencity: | 0.048 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.059 |
Respiratory Toxicity: | 0.843 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005963 | ![]() |
0.694 | D0V2JK | ![]() |
0.336 | ||
ENC001949 | ![]() |
0.561 | D0X4RS | ![]() |
0.323 | ||
ENC003457 | ![]() |
0.560 | D0H2MO | ![]() |
0.314 | ||
ENC004115 | ![]() |
0.538 | D04GJN | ![]() |
0.308 | ||
ENC002012 | ![]() |
0.534 | D0I2SD | ![]() |
0.298 | ||
ENC003138 | ![]() |
0.521 | D0R2KY | ![]() |
0.295 | ||
ENC005965 | ![]() |
0.488 | D08BDT | ![]() |
0.291 | ||
ENC002033 | ![]() |
0.441 | D06AEO | ![]() |
0.290 | ||
ENC005629 | ![]() |
0.391 | D02CNR | ![]() |
0.287 | ||
ENC003376 | ![]() |
0.389 | D02CJX | ![]() |
0.281 |