![]() |
Name |
Lup-20(29)-en-3-ol, acetate, (3beta)-
|
Molecular Formula | C32H52O2 | |
IUPAC Name* |
[(9R)-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate
|
|
SMILES |
CC(=C)C1CCC2(C1C3CCC4C5(CC[C@H](C(C5CCC4(C3(CC2)C)C)(C)C)OC(=O)C)C)C
|
|
InChI |
InChI=1S/C32H52O2/c1-20(2)22-12-15-29(6)18-19-31(8)23(27(22)29)10-11-25-30(7)16-14-26(34-21(3)33)28(4,5)24(30)13-17-32(25,31)9/h22-27H,1,10-19H2,2-9H3/t22?,23?,24?,25?,26-,27?,29?,30?,31?,32?/m1/s1
|
|
InChIKey |
ODSSDTBFHAYYMD-GOMFNVQHSA-N
|
|
Synonyms |
Lup-20(29)-en-3.beta.-ol, acetate; 20(29)-Lupenol acetate; Lup-20(29)-en-3-ol, acetate, (3.beta.)-; Lup-20(29)-en-3-yl acetate #
|
|
CAS | NA | |
PubChem CID | 6432150 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 468.8 | ALogp: | 10.4 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 5 |
Heavy Atoms: | 34 | QED Weighted: | 0.273 |
Caco-2 Permeability: | -4.958 | MDCK Permeability: | 0.00000838 |
Pgp-inhibitor: | 0.462 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.052 |
30% Bioavailability (F30%): | 0.909 |
Blood-Brain-Barrier Penetration (BBB): | 0.595 | Plasma Protein Binding (PPB): | 100.23% |
Volume Distribution (VD): | 1.88 | Fu: | 2.07% |
CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.472 |
CYP2C19-inhibitor: | 0.065 | CYP2C19-substrate: | 0.967 |
CYP2C9-inhibitor: | 0.074 | CYP2C9-substrate: | 0.403 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.686 |
CYP3A4-inhibitor: | 0.16 | CYP3A4-substrate: | 0.614 |
Clearance (CL): | 5.277 | Half-life (T1/2): | 0.01 |
hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.302 |
Drug-inuced Liver Injury (DILI): | 0.099 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.21 | Maximum Recommended Daily Dose: | 0.872 |
Skin Sensitization: | 0.055 | Carcinogencity: | 0.01 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.051 |
Respiratory Toxicity: | 0.757 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001745 | ![]() |
0.424 | D03MTN | ![]() |
0.360 | ||
ENC001394 | ![]() |
0.405 | D00VZZ | ![]() |
0.311 | ||
ENC002119 | ![]() |
0.394 | D0X7XG | ![]() |
0.308 | ||
ENC001949 | ![]() |
0.392 | D09NNA | ![]() |
0.302 | ||
ENC001582 | ![]() |
0.381 | D0R2KY | ![]() |
0.298 | ||
ENC005285 | ![]() |
0.376 | D0B4RU | ![]() |
0.279 | ||
ENC005544 | ![]() |
0.373 | D02CJX | ![]() |
0.275 | ||
ENC000865 | ![]() |
0.364 | D0XX6Y | ![]() |
0.271 | ||
ENC003457 | ![]() |
0.353 | D04DJN | ![]() |
0.269 | ||
ENC001980 | ![]() |
0.351 | D07BSQ | ![]() |
0.268 |