![]() |
Name |
Citreohybridonol
|
Molecular Formula | C28H36O8 | |
IUPAC Name* |
methyl (1R,2S,5R,9R,10S,12S,15S)-15-acetyloxy-6-hydroxy-4,5,7,10,14,14-hexamethyl-8,18-dioxo-19-oxapentacyclo[10.5.2.01,13.02,10.05,9]nonadeca-3,6-diene-9-carboxylate
|
|
SMILES |
CC1=C[C@H]2[C@](C[C@H]3C4[C@]2(CC[C@@H](C4(C)C)OC(=O)C)C(=O)O3)([C@]5([C@@]1(C(=C(C5=O)C)O)C)C(=O)OC)C
|
|
InChI |
InChI=1S/C28H36O8/c1-13-11-17-25(6,28(23(33)34-8)21(31)14(2)20(30)26(13,28)7)12-16-19-24(4,5)18(35-15(3)29)9-10-27(17,19)22(32)36-16/h11,16-19,30H,9-10,12H2,1-8H3/t16-,17-,18-,19?,25-,26-,27+,28+/m0/s1
|
|
InChIKey |
MYLOBISKHDRNEW-USNZOBNTSA-N
|
|
Synonyms |
Citreohybridonol
|
|
CAS | NA | |
PubChem CID | 101252260 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 500.6 | ALogp: | 3.3 |
HBD: | 1 | HBA: | 8 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 116.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 36 | QED Weighted: | 0.255 |
Caco-2 Permeability: | -5.223 | MDCK Permeability: | 0.00003950 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.024 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.228 |
30% Bioavailability (F30%): | 0.838 |
Blood-Brain-Barrier Penetration (BBB): | 0.558 | Plasma Protein Binding (PPB): | 68.08% |
Volume Distribution (VD): | 0.55 | Fu: | 30.31% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.428 |
CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.88 |
CYP2C9-inhibitor: | 0.042 | CYP2C9-substrate: | 0.055 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.097 |
CYP3A4-inhibitor: | 0.596 | CYP3A4-substrate: | 0.899 |
Clearance (CL): | 5.221 | Half-life (T1/2): | 0.141 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.2 |
Drug-inuced Liver Injury (DILI): | 0.767 | AMES Toxicity: | 0.033 |
Rat Oral Acute Toxicity: | 0.807 | Maximum Recommended Daily Dose: | 0.084 |
Skin Sensitization: | 0.032 | Carcinogencity: | 0.623 |
Eye Corrosion: | 0.992 | Eye Irritation: | 0.227 |
Respiratory Toxicity: | 0.957 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001949 | ![]() |
0.673 | D0H2MO | ![]() |
0.301 | ||
ENC004115 | ![]() |
0.658 | D09WYX | ![]() |
0.262 | ||
ENC002012 | ![]() |
0.655 | D08BDT | ![]() |
0.262 | ||
ENC002033 | ![]() |
0.558 | D03ZZK | ![]() |
0.260 | ||
ENC003457 | ![]() |
0.533 | D0V2JK | ![]() |
0.252 | ||
ENC005963 | ![]() |
0.524 | D0X4RS | ![]() |
0.252 | ||
ENC005965 | ![]() |
0.524 | D01ZOG | ![]() |
0.247 | ||
ENC005964 | ![]() |
0.521 | D0G7KJ | ![]() |
0.245 | ||
ENC005629 | ![]() |
0.333 | D0X7XG | ![]() |
0.244 | ||
ENC003776 | ![]() |
0.331 | D0Q4SD | ![]() |
0.243 |