![]() |
Name |
3beta-(beta-D-glucopyranosyloxy)olean-12-ene-23,28,30-trioic acid
|
Molecular Formula | C36H54O12 | |
IUPAC Name* |
(2S,4aR,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-2,6a,6b,9,12a-pentamethyl-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2,4a,9-tricarboxylic acid
|
|
SMILES |
C[C@@]1(CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H]([C@@]5(C)C(=O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C)[C@@H]2C1)C)C(=O)O)C(=O)O
|
|
InChI |
InChI=1S/C36H54O12/c1-31(28(41)42)12-14-36(30(45)46)15-13-33(3)18(19(36)16-31)6-7-21-32(2)10-9-23(35(5,29(43)44)22(32)8-11-34(21,33)4)48-27-26(40)25(39)24(38)20(17-37)47-27/h6,19-27,37-40H,7-17H2,1-5H3,(H,41,42)(H,43,44)(H,45,46)/t19-,20+,21+,22+,23-,24+,25-,26+,27-,31-,32+,33+,34+,35-,36-/m0/s1
|
|
InChIKey |
XKEWZDPNBGRTEL-SFBVZPQOSA-N
|
|
Synonyms |
3beta-(beta-D-glucopyranosyloxy)olean-12-ene-23,28,30-trioic acid
|
|
CAS | NA | |
PubChem CID | 146682840 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 678.8 | ALogp: | 2.9 |
HBD: | 7 | HBA: | 12 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 211.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 48 | QED Weighted: | 0.157 |
Caco-2 Permeability: | -6.378 | MDCK Permeability: | 0.00000936 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.873 | 20% Bioavailability (F20%): | 0.215 |
30% Bioavailability (F30%): | 0.774 |
Blood-Brain-Barrier Penetration (BBB): | 0.163 | Plasma Protein Binding (PPB): | 77.35% |
Volume Distribution (VD): | 0.313 | Fu: | 13.53% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.864 |
CYP2C19-inhibitor: | 0.002 | CYP2C19-substrate: | 0.13 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.046 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.036 |
CYP3A4-inhibitor: | 0.078 | CYP3A4-substrate: | 0.016 |
Clearance (CL): | 0.916 | Half-life (T1/2): | 0.807 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.191 |
Drug-inuced Liver Injury (DILI): | 0.005 | AMES Toxicity: | 0.048 |
Rat Oral Acute Toxicity: | 0.11 | Maximum Recommended Daily Dose: | 0.614 |
Skin Sensitization: | 0.039 | Carcinogencity: | 0.381 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.045 |
Respiratory Toxicity: | 0.96 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003286 | ![]() |
0.606 | D03MTN | ![]() |
0.455 | ||
ENC000865 | ![]() |
0.436 | D07QQD | ![]() |
0.409 | ||
ENC005544 | ![]() |
0.399 | D0P2IT | ![]() |
0.403 | ||
ENC002246 | ![]() |
0.383 | D04RYU | ![]() |
0.342 | ||
ENC001938 | ![]() |
0.378 | D0M2QH | ![]() |
0.331 | ||
ENC001939 | ![]() |
0.378 | D04MRG | ![]() |
0.330 | ||
ENC002265 | ![]() |
0.376 | D0AR3J | ![]() |
0.310 | ||
ENC001394 | ![]() |
0.373 | D0S0NK | ![]() |
0.304 | ||
ENC001918 | ![]() |
0.368 | D09HTS | ![]() |
0.303 | ||
ENC004550 | ![]() |
0.350 | D0P6IK | ![]() |
0.296 |