|
Name |
Xylarioxide F
|
Molecular Formula | C34H56O10 | |
IUPAC Name* |
17-[5,6-dimethyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-3-en-2-yl]-3,5,6-trihydroxy-10,13-dimethyl-2,3,4,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-one
|
|
SMILES |
CC(C=CC(C)C(C)(C)OC1OC(CO)C(O)C(O)C1O)C1CCC2C3C(=O)C(O)C4(O)CC(O)CCC4(C)C3CCC12C
|
|
InChI |
InChI=1S/C34H56O10/c1-17(7-8-18(2)31(3,4)44-30-28(40)27(39)25(37)23(16-35)43-30)20-9-10-21-24-22(12-13-32(20,21)5)33(6)14-11-19(36)15-34(33,42)29(41)26(24)38/h7-8,17-25,27-30,35-37,39-42H,9-16H2,1-6H3/b8-7+/t17-,18+,19+,20-,21+,22+,23?,24+,25?,27?,28?,29-,30?,32-,33-,34+/m1/s1
|
|
InChIKey |
FRZPLUXCILWDOF-MUEZYAMUSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 624.81 | ALogp: | 1.7 |
HBD: | 7 | HBA: | 10 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 177.1 | Aromatic Rings: | 5 |
Heavy Atoms: | 44 | QED Weighted: | 0.208 |
Caco-2 Permeability: | -5.025 | MDCK Permeability: | 0.00014748 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.215 |
Human Intestinal Absorption (HIA): | 0.757 | 20% Bioavailability (F20%): | 0.042 |
30% Bioavailability (F30%): | 0.108 |
Blood-Brain-Barrier Penetration (BBB): | 0.127 | Plasma Protein Binding (PPB): | 95.32% |
Volume Distribution (VD): | 0.75 | Fu: | 5.19% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.131 |
CYP2C19-inhibitor: | 0.001 | CYP2C19-substrate: | 0.644 |
CYP2C9-inhibitor: | 0.001 | CYP2C9-substrate: | 0.091 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.167 |
CYP3A4-inhibitor: | 0.025 | CYP3A4-substrate: | 0.134 |
Clearance (CL): | 2.022 | Half-life (T1/2): | 0.063 |
hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.054 |
Drug-inuced Liver Injury (DILI): | 0.073 | AMES Toxicity: | 0.052 |
Rat Oral Acute Toxicity: | 0.94 | Maximum Recommended Daily Dose: | 0.138 |
Skin Sensitization: | 0.015 | Carcinogencity: | 0.011 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0.062 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001889 | 0.520 | D04RYU | 0.422 | ||||
ENC004803 | 0.471 | D0AR3J | 0.353 | ||||
ENC004549 | 0.448 | D0P6IK | 0.338 | ||||
ENC001769 | 0.444 | D0M2QH | 0.337 | ||||
ENC001918 | 0.425 | D09HTS | 0.335 | ||||
ENC005016 | 0.424 | D0M4WA | 0.333 | ||||
ENC004757 | 0.423 | D07TGN | 0.320 | ||||
ENC005438 | 0.423 | D03ZTE | 0.318 | ||||
ENC001984 | 0.423 | D0G3SH | 0.318 | ||||
ENC004804 | 0.423 | D0N1TP | 0.316 |