![]() |
Name |
ginsenoside F2
|
Molecular Formula | C42H72O13 | |
IUPAC Name* |
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(3S,5R,8R,9R,10R,12R,13R,14R,17S)-12-hydroxy-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol
|
|
SMILES |
CC(=CCC[C@@](C)([C@H]1CC[C@@]2([C@@H]1[C@@H](C[C@H]3[C@]2(CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)O)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C
|
|
InChI |
InChI=1S/C42H72O13/c1-21(2)10-9-14-42(8,55-37-35(51)33(49)31(47)25(20-44)53-37)22-11-16-41(7)29(22)23(45)18-27-39(5)15-13-28(38(3,4)26(39)12-17-40(27,41)6)54-36-34(50)32(48)30(46)24(19-43)52-36/h10,22-37,43-51H,9,11-20H2,1-8H3/t22-,23+,24+,25+,26-,27+,28-,29-,30+,31+,32-,33-,34+,35+,36-,37-,39-,40+,41+,42-/m0/s1
|
|
InChIKey |
SWIROVJVGRGSPO-JBVRGBGGSA-N
|
|
Synonyms |
ginsenoside F2; 62025-49-4; CHEMBL1095007; CHEBI:77145; 20(S)-Ginsenoside-F2; ginsenoside-F2; Sg(S)-ginsenoside f2; (20S)-ginsenoside F2; SCHEMBL17576511; DTXSID20432763; BDBM50317538; MFCD06410948; s9044; ZINC96095534; AKOS037514666; CCG-270474; HY-125848; CS-0009605; C20779; 025S494; Q-100717; Q27146699; 3beta,20-bis(beta-D-glucopyranosyloxy)dammar-24-en-12beta-ol; (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(3S,5R,8R,9R,10R,12R,13R,14R, 17S)-12-hydroxy-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S, 5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-2, 3,5,6,7,9,11,12,13,15,16, 17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol; (3beta,12beta)-20-(beta-D-glucopyranosyloxy)-12-hydroxydammar-24-en-3-yl beta-D-glucopyranoside
|
|
CAS | 62025-49-4 | |
PubChem CID | 9918692 | |
ChEMBL ID | CHEMBL1095007 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 785.0 | ALogp: | 4.0 |
HBD: | 9 | HBA: | 13 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 219.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 55 | QED Weighted: | 0.115 |
Caco-2 Permeability: | -5.491 | MDCK Permeability: | 0.00003590 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.877 | 20% Bioavailability (F20%): | 0.8 |
30% Bioavailability (F30%): | 0.98 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 81.16% |
Volume Distribution (VD): | 0.373 | Fu: | 8.01% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.113 |
CYP2C19-inhibitor: | 0.001 | CYP2C19-substrate: | 0.49 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.026 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.078 |
CYP3A4-inhibitor: | 0.025 | CYP3A4-substrate: | 0.043 |
Clearance (CL): | 0.75 | Half-life (T1/2): | 0.62 |
hERG Blockers: | 0.147 | Human Hepatotoxicity (H-HT): | 0.15 |
Drug-inuced Liver Injury (DILI): | 0.007 | AMES Toxicity: | 0.053 |
Rat Oral Acute Toxicity: | 0.102 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.908 | Carcinogencity: | 0.007 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.666 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001939 | ![]() |
0.862 | D04MRG | ![]() |
0.461 | ||
ENC002180 | ![]() |
0.831 | D07QQD | ![]() |
0.457 | ||
ENC002655 | ![]() |
0.831 | D0P2IT | ![]() |
0.430 | ||
ENC000865 | ![]() |
0.739 | D04RYU | ![]() |
0.382 | ||
ENC002245 | ![]() |
0.729 | D03MTN | ![]() |
0.380 | ||
ENC001894 | ![]() |
0.729 | D07ORO | ![]() |
0.366 | ||
ENC001933 | ![]() |
0.712 | D0A8RX | ![]() |
0.352 | ||
ENC001918 | ![]() |
0.675 | D0YV1Q | ![]() |
0.333 | ||
ENC002246 | ![]() |
0.614 | D0Y3MO | ![]() |
0.328 | ||
ENC002265 | ![]() |
0.485 | D04NDM | ![]() |
0.325 |