![]() |
Name |
(1S,4S,5S,9R,11S,14S,15R,19R)-5,15-dihydroxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docosa-6,16-diene-2,8,12,18-tetrone
|
Molecular Formula | C18H16N2O6S2 | |
IUPAC Name* |
(1S,4S,5S,9R,11S,14S,15R,19R)-5,15-dihydroxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docosa-6,16-diene-2,8,12,18-tetrone
|
|
SMILES |
C1[C@@H]2[C@@H]([C@@H](C=CC2=O)O)N3[C@@]14C(=O)N5[C@H]6[C@@H](C[C@@]5(C3=O)SS4)C(=O)C=C[C@@H]6O
|
|
InChI |
InChI=1S/C18H16N2O6S2/c21-9-1-3-11(23)13-7(9)5-17-15(25)20-14-8(10(22)2-4-12(14)24)6-18(20,28-27-17)16(26)19(13)17/h1-4,7-8,11-14,23-24H,5-6H2/t7-,8-,11-,12+,13-,14-,17-,18-/m0/s1
|
|
InChIKey |
RCODXLGTKJXDNC-ZSWOQMQUSA-N
|
|
Synonyms |
Epicorazine A
|
|
CAS | NA | |
PubChem CID | 139589132 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 420.5 | ALogp: | -1.7 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 166.0 | Aromatic Rings: | 7 |
Heavy Atoms: | 28 | QED Weighted: | 0.513 |
Caco-2 Permeability: | -5.19 | MDCK Permeability: | 0.00001840 |
Pgp-inhibitor: | 0.875 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.161 |
Blood-Brain-Barrier Penetration (BBB): | 0.058 | Plasma Protein Binding (PPB): | 43.51% |
Volume Distribution (VD): | 0.474 | Fu: | 55.37% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.114 |
CYP2C19-inhibitor: | 0.153 | CYP2C19-substrate: | 0.334 |
CYP2C9-inhibitor: | 0.788 | CYP2C9-substrate: | 0.593 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.07 |
CYP3A4-inhibitor: | 0.191 | CYP3A4-substrate: | 0.975 |
Clearance (CL): | 10.874 | Half-life (T1/2): | 0.405 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.135 |
Drug-inuced Liver Injury (DILI): | 0.996 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.973 | Maximum Recommended Daily Dose: | 0.411 |
Skin Sensitization: | 0.603 | Carcinogencity: | 0.402 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.046 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004752 | ![]() |
0.481 | D0WE3O | ![]() |
0.190 | ||
ENC003596 | ![]() |
0.455 | D0U7GK | ![]() |
0.180 | ||
ENC003573 | ![]() |
0.333 | D0W7RJ | ![]() |
0.180 | ||
ENC002661 | ![]() |
0.311 | D03IKT | ![]() |
0.177 | ||
ENC003671 | ![]() |
0.311 | D00GOS | ![]() |
0.177 | ||
ENC000134 | ![]() |
0.295 | D0F1EX | ![]() |
0.177 | ||
ENC003617 | ![]() |
0.286 | D03DIG | ![]() |
0.175 | ||
ENC003673 | ![]() |
0.281 | D0I5DS | ![]() |
0.171 | ||
ENC005849 | ![]() |
0.279 | D0V9DZ | ![]() |
0.171 | ||
ENC003788 | ![]() |
0.279 | D0CZ1Q | ![]() |
0.171 |