![]() |
Name |
Penicibrocazine D
|
Molecular Formula | C20H26N2O6S2 | |
IUPAC Name* |
(1R,4R,5S,9S,11R,14S,15S,19R)-5,15-dihydroxy-1,11-bis(methylsulfanyl)-3,13-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosane-2,8,12,18-tetrone
|
|
SMILES |
CS[C@@]12C[C@@H]3[C@H](N1C(=O)[C@@]4(C[C@H]5[C@@H](N4C2=O)[C@H](CCC5=O)O)SC)[C@H](CCC3=O)O
|
|
InChI |
InChI=1S/C20H26N2O6S2/c1-29-19-7-9-11(23)3-5-13(25)15(9)21(19)18(28)20(30-2)8-10-12(24)4-6-14(26)16(10)22(20)17(19)27/h9-10,13-16,25-26H,3-8H2,1-2H3/t9-,10+,13-,14-,15-,16+,19+,20+/m0/s1
|
|
InChIKey |
FZVZQZDYZWKKHU-XQDXIULDSA-N
|
|
Synonyms |
Penicibrocazine D
|
|
CAS | NA | |
PubChem CID | 139585885 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 454.6 | ALogp: | -0.9 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 166.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 30 | QED Weighted: | 0.616 |
Caco-2 Permeability: | -4.983 | MDCK Permeability: | 0.00001670 |
Pgp-inhibitor: | 0.298 | Pgp-substrate: | 0.744 |
Human Intestinal Absorption (HIA): | 0.545 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.092 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 64.88% |
Volume Distribution (VD): | 0.456 | Fu: | 39.54% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.18 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.906 |
CYP2C9-inhibitor: | 0.195 | CYP2C9-substrate: | 0.107 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.044 |
CYP3A4-inhibitor: | 0.066 | CYP3A4-substrate: | 0.975 |
Clearance (CL): | 7.16 | Half-life (T1/2): | 0.929 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.259 |
Drug-inuced Liver Injury (DILI): | 0.98 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.907 | Maximum Recommended Daily Dose: | 0.888 |
Skin Sensitization: | 0.341 | Carcinogencity: | 0.714 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.002 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002661 | ![]() |
1.000 | D0I1LH | ![]() |
0.232 | ||
ENC003596 | ![]() |
0.745 | D04SFH | ![]() |
0.230 | ||
ENC003673 | ![]() |
0.674 | D0IX6I | ![]() |
0.224 | ||
ENC003573 | ![]() |
0.414 | D0KR5B | ![]() |
0.224 | ||
ENC003617 | ![]() |
0.402 | D0X4RS | ![]() |
0.211 | ||
ENC003809 | ![]() |
0.311 | D00YWP | ![]() |
0.209 | ||
ENC000993 | ![]() |
0.263 | D0W3OS | ![]() |
0.207 | ||
ENC004418 | ![]() |
0.254 | D0G8BV | ![]() |
0.207 | ||
ENC003035 | ![]() |
0.248 | D06XMU | ![]() |
0.205 | ||
ENC005140 | ![]() |
0.246 | D0Z1FX | ![]() |
0.205 |