![]() |
Name |
(4S,7Z,9R,10S,13Z,15R,16S)-9,15-dihydroxy-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione
|
Molecular Formula | C16H22O8 | |
IUPAC Name* |
(4S,7Z,9R,10S,13Z,15R,16S)-9,15-dihydroxy-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione
|
|
SMILES |
C[C@H]1CC(=O)O[C@H]([C@@H](/C=C\C(=O)O[C@H]([C@@H](/C=C\C(=O)O1)O)C)O)C
|
|
InChI |
InChI=1S/C16H22O8/c1-9-8-16(21)24-11(3)13(18)5-7-15(20)23-10(2)12(17)4-6-14(19)22-9/h4-7,9-13,17-18H,8H2,1-3H3/b6-4-,7-5-/t9-,10-,11-,12+,13+/m0/s1
|
|
InChIKey |
MJMMUATWVTYSFD-MGQLGLDKSA-N
|
|
Synonyms |
Macrosphelide A; 172923-77-2
|
|
CAS | NA | |
PubChem CID | 139588335 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 342.34 | ALogp: | 0.3 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 119.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 24 | QED Weighted: | 0.48 |
Caco-2 Permeability: | -4.493 | MDCK Permeability: | 0.00006450 |
Pgp-inhibitor: | 0.994 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.991 |
Blood-Brain-Barrier Penetration (BBB): | 0.801 | Plasma Protein Binding (PPB): | 49.18% |
Volume Distribution (VD): | 0.302 | Fu: | 50.20% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.047 |
CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.051 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.112 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.103 |
CYP3A4-inhibitor: | 0.034 | CYP3A4-substrate: | 0.219 |
Clearance (CL): | 9.125 | Half-life (T1/2): | 0.935 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.072 |
Drug-inuced Liver Injury (DILI): | 0.833 | AMES Toxicity: | 0.72 |
Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.43 |
Skin Sensitization: | 0.77 | Carcinogencity: | 0.741 |
Eye Corrosion: | 0.998 | Eye Irritation: | 0.487 |
Respiratory Toxicity: | 0.02 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005849 | ![]() |
1.000 | D06WTZ | ![]() |
0.241 | ||
ENC002121 | ![]() |
0.726 | D0H0ND | ![]() |
0.237 | ||
ENC005850 | ![]() |
0.707 | D03KXY | ![]() |
0.225 | ||
ENC001946 | ![]() |
0.512 | D02FEM | ![]() |
0.220 | ||
ENC003456 | ![]() |
0.459 | D0WE3O | ![]() |
0.216 | ||
ENC001867 | ![]() |
0.393 | D0K7LU | ![]() |
0.215 | ||
ENC003403 | ![]() |
0.393 | D02PCR | ![]() |
0.214 | ||
ENC001860 | ![]() |
0.364 | D03DIG | ![]() |
0.210 | ||
ENC001433 | ![]() |
0.360 | D00OAY | ![]() |
0.205 | ||
ENC004602 | ![]() |
0.348 | D0J7OG | ![]() |
0.204 |