![]() |
Name |
Penicisulfuranol B
|
Molecular Formula | C21H22N2O9S2 | |
IUPAC Name* |
(1R,5S,6R,9R,10S,12R,15R)-6,9,10-trihydroxy-19,20-dimethoxy-23-methyl-4,22-dioxa-13,14-dithia-3,23-diazahexacyclo[10.10.2.01,15.03,12.05,10.016,21]tetracosa-7,16(21),17,19-tetraene-2,24-dione
|
|
SMILES |
CN1C(=O)[C@]23C[C@@]4([C@@H](C=C[C@H]([C@@H]4ON2C(=O)[C@@]15[C@@H](C6=C(O5)C(=C(C=C6)OC)OC)SS3)O)O)O
|
|
InChI |
InChI=1S/C21H22N2O9S2/c1-22-17(26)20-8-19(28)12(25)7-5-10(24)15(19)32-23(20)18(27)21(22)16(33-34-20)9-4-6-11(29-2)14(30-3)13(9)31-21/h4-7,10,12,15-16,24-25,28H,8H2,1-3H3/t10-,12-,15+,16-,19+,20-,21+/m1/s1
|
|
InChIKey |
WHVFNXVGORSIGM-OFDQUPMBSA-N
|
|
Synonyms |
Penicisulfuranol B; CHEMBL4095250
|
|
CAS | NA | |
PubChem CID | 137652642 | |
ChEMBL ID | CHEMBL4095250 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 510.5 | ALogp: | -1.0 |
HBD: | 3 | HBA: | 11 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 189.0 | Aromatic Rings: | 7 |
Heavy Atoms: | 34 | QED Weighted: | 0.376 |
Caco-2 Permeability: | -5.375 | MDCK Permeability: | 0.00002110 |
Pgp-inhibitor: | 0.838 | Pgp-substrate: | 0.222 |
Human Intestinal Absorption (HIA): | 0.8 | 20% Bioavailability (F20%): | 0.676 |
30% Bioavailability (F30%): | 0.984 |
Blood-Brain-Barrier Penetration (BBB): | 0.213 | Plasma Protein Binding (PPB): | 69.74% |
Volume Distribution (VD): | 1.112 | Fu: | 38.81% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.839 |
CYP2C19-inhibitor: | 0.081 | CYP2C19-substrate: | 0.902 |
CYP2C9-inhibitor: | 0.419 | CYP2C9-substrate: | 0.198 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.102 |
CYP3A4-inhibitor: | 0.392 | CYP3A4-substrate: | 0.946 |
Clearance (CL): | 5.04 | Half-life (T1/2): | 0.62 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.251 |
Drug-inuced Liver Injury (DILI): | 0.98 | AMES Toxicity: | 0.523 |
Rat Oral Acute Toxicity: | 0.935 | Maximum Recommended Daily Dose: | 0.288 |
Skin Sensitization: | 0.423 | Carcinogencity: | 0.864 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.505 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003540 | ![]() |
0.929 | D03DIG | ![]() |
0.298 | ||
ENC003544 | ![]() |
0.880 | D0L1JW | ![]() |
0.279 | ||
ENC003539 | ![]() |
0.699 | D04TDQ | ![]() |
0.270 | ||
ENC003546 | ![]() |
0.613 | D0D4HN | ![]() |
0.243 | ||
ENC003659 | ![]() |
0.609 | D0WE3O | ![]() |
0.242 | ||
ENC003549 | ![]() |
0.571 | D06GCK | ![]() |
0.235 | ||
ENC004277 | ![]() |
0.545 | D03SKD | ![]() |
0.233 | ||
ENC003738 | ![]() |
0.525 | D0R9VR | ![]() |
0.232 | ||
ENC003595 | ![]() |
0.480 | D0T6WT | ![]() |
0.232 | ||
ENC006030 | ![]() |
0.480 | D0F7CS | ![]() |
0.231 |