![]() |
Name |
Penicisulfuranol E
|
Molecular Formula | C23H28N2O9S2 | |
IUPAC Name* |
(2R,3R,6'aS,7'R,10'R,10'aS,11'aR)-7',10',10'a-trihydroxy-6,7-dimethoxy-2'-methyl-3,11'a-bis(methylsulfanyl)spiro[3H-1-benzofuran-2,3'-6a,7,10,11-tetrahydropyrazino[1,2-b][1,2]benzoxazine]-1',4'-dione
|
|
SMILES |
CN1C(=O)[C@@]2(C[C@@]3([C@@H](C=C[C@H]([C@@H]3ON2C(=O)[C@@]14[C@@H](C5=C(O4)C(=C(C=C5)OC)OC)SC)O)O)O)SC
|
|
InChI |
InChI=1S/C23H28N2O9S2/c1-24-19(28)22(36-5)10-21(30)14(27)9-7-12(26)17(21)34-25(22)20(29)23(24)18(35-4)11-6-8-13(31-2)16(32-3)15(11)33-23/h6-9,12,14,17-18,26-27,30H,10H2,1-5H3/t12-,14-,17+,18-,21+,22-,23+/m1/s1
|
|
InChIKey |
NBQWNKSLYYEGEL-IXFSHVHNSA-N
|
|
Synonyms |
Penicisulfuranol E; CHEMBL4070482
|
|
CAS | NA | |
PubChem CID | 137639231 | |
ChEMBL ID | CHEMBL4070482 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 540.6 | ALogp: | -0.1 |
HBD: | 3 | HBA: | 11 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 189.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 36 | QED Weighted: | 0.465 |
Caco-2 Permeability: | -5.432 | MDCK Permeability: | 0.00001340 |
Pgp-inhibitor: | 0.993 | Pgp-substrate: | 0.992 |
Human Intestinal Absorption (HIA): | 0.943 | 20% Bioavailability (F20%): | 0.845 |
30% Bioavailability (F30%): | 0.954 |
Blood-Brain-Barrier Penetration (BBB): | 0.178 | Plasma Protein Binding (PPB): | 84.68% |
Volume Distribution (VD): | 1.118 | Fu: | 8.20% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.934 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.897 |
CYP2C9-inhibitor: | 0.11 | CYP2C9-substrate: | 0.119 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.089 |
CYP3A4-inhibitor: | 0.376 | CYP3A4-substrate: | 0.954 |
Clearance (CL): | 2.997 | Half-life (T1/2): | 0.749 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.319 |
Drug-inuced Liver Injury (DILI): | 0.962 | AMES Toxicity: | 0.139 |
Rat Oral Acute Toxicity: | 0.799 | Maximum Recommended Daily Dose: | 0.032 |
Skin Sensitization: | 0.229 | Carcinogencity: | 0.818 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.02 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003546 | ![]() |
0.885 | D03DIG | ![]() |
0.288 | ||
ENC003549 | ![]() |
0.819 | D0L1JW | ![]() |
0.271 | ||
ENC003545 | ![]() |
0.699 | D04TDQ | ![]() |
0.271 | ||
ENC003595 | ![]() |
0.684 | D0D4HN | ![]() |
0.236 | ||
ENC003540 | ![]() |
0.681 | D09DHY | ![]() |
0.236 | ||
ENC004277 | ![]() |
0.619 | D02LZB | ![]() |
0.236 | ||
ENC003544 | ![]() |
0.613 | D0WE3O | ![]() |
0.234 | ||
ENC003738 | ![]() |
0.610 | D01FFA | ![]() |
0.229 | ||
ENC003659 | ![]() |
0.500 | D06GCK | ![]() |
0.228 | ||
ENC004276 | ![]() |
0.426 | D03SKD | ![]() |
0.226 |