|
Name |
7-chloro-3-[[6-hydroxy-1,4-dimethoxy-7-[4-(2-methoxy-2-oxoethyl)-6-methyl-1,3-dioxan-2-yl]-3-oxo-1H-2-benzofuran-5-yl]methoxy]-3,4a,8,8-tetramethyl-1a,2,4,5,6,7-hexahydronaphtho[4,4a-b]oxirene-4-carboxylic acid
|
Molecular Formula | C34H45ClO13 | |
IUPAC Name* |
7-chloro-3-[[6-hydroxy-1,4-dimethoxy-7-[4-(2-methoxy-2-oxoethyl)-6-methyl-1,3-dioxan-2-yl]-3-oxo-1H-2-benzofuran-5-yl]methoxy]-3,4a,8,8-tetramethyl-1a,2,4,5,6,7-hexahydronaphtho[4,4a-b]oxirene-4-carboxylic acid
|
|
SMILES |
CC1CC(OC(O1)C2=C3C(OC(=O)C3=C(C(=C2O)COC4(CC5C6(O5)C(C(CCC6(C4C(=O)O)C)Cl)(C)C)C)OC)OC)CC(=O)OC
|
|
InChI |
InChI=1S/C34H45ClO13/c1-15-11-16(12-20(36)41-6)46-30(45-15)22-21-23(28(40)47-29(21)43-8)25(42-7)17(24(22)37)14-44-33(5)13-19-34(48-19)31(2,3)18(35)9-10-32(34,4)26(33)27(38)39/h15-16,18-19,26,29-30,37H,9-14H2,1-8H3,(H,38,39)
|
|
InChIKey |
GRTLMVCOFHTXMV-UHFFFAOYSA-N
|
|
Synonyms |
Pestalotiopen B
|
|
CAS | NA | |
PubChem CID | 102501044 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 697.2 | ALogp: | 3.2 |
HBD: | 2 | HBA: | 13 |
Rotatable Bonds: | 10 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 169.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 48 | QED Weighted: | 0.194 |
Caco-2 Permeability: | -5.481 | MDCK Permeability: | 0.00000865 |
Pgp-inhibitor: | 0.121 | Pgp-substrate: | 0.094 |
Human Intestinal Absorption (HIA): | 0.057 | 20% Bioavailability (F20%): | 0.018 |
30% Bioavailability (F30%): | 0.084 |
Blood-Brain-Barrier Penetration (BBB): | 0.134 | Plasma Protein Binding (PPB): | 88.28% |
Volume Distribution (VD): | 0.889 | Fu: | 8.31% |
CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.965 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.9 |
CYP2C9-inhibitor: | 0.105 | CYP2C9-substrate: | 0.329 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.17 |
CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.329 |
Clearance (CL): | 8.293 | Half-life (T1/2): | 0.201 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.365 |
Drug-inuced Liver Injury (DILI): | 0.974 | AMES Toxicity: | 0.281 |
Rat Oral Acute Toxicity: | 0.979 | Maximum Recommended Daily Dose: | 0.383 |
Skin Sensitization: | 0.135 | Carcinogencity: | 0.829 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.073 |
Respiratory Toxicity: | 0.883 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003275 | 0.681 | D0X7XG | 0.238 | ||||
ENC002424 | 0.348 | D04JMQ | 0.233 | ||||
ENC002386 | 0.280 | D0Z1ZM | 0.231 | ||||
ENC003564 | 0.274 | D0Y2YP | 0.230 | ||||
ENC003138 | 0.271 | D01UBX | 0.230 | ||||
ENC002012 | 0.269 | D0H2MO | 0.230 | ||||
ENC004115 | 0.266 | D0E4SI | 0.228 | ||||
ENC001949 | 0.259 | D02JNM | 0.225 | ||||
ENC003163 | 0.258 | D03ZZK | 0.224 | ||||
ENC005965 | 0.258 | D02YIZ | 0.223 |