|
Name |
Chrodrimanin B
|
Molecular Formula | C27H32O8 | |
IUPAC Name* |
[(1S,5R,6R,14R,15S,17R,22S)-10,15-dihydroxy-6,14,18,18,22-pentamethyl-8,19-dioxo-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraen-5-yl] acetate
|
|
SMILES |
C[C@@H]1[C@@H](C2=C(C(=CC3=C2C[C@H]4[C@]5(C=CC(=O)C([C@@H]5C[C@@H]([C@@]4(O3)C)O)(C)C)C)O)C(=O)O1)OC(=O)C
|
|
InChI |
InChI=1S/C27H32O8/c1-12-23(34-13(2)28)21-14-9-18-26(5)8-7-19(30)25(3,4)17(26)11-20(31)27(18,6)35-16(14)10-15(29)22(21)24(32)33-12/h7-8,10,12,17-18,20,23,29,31H,9,11H2,1-6H3/t12-,17+,18+,20+,23+,26+,27-/m1/s1
|
|
InChIKey |
DYQKBALSPZQWQD-FWEFFTEASA-N
|
|
Synonyms |
Chrodrimanin B; 132196-54-4; (1R,2R,7aR,8S,9aR,13aS,13bS)-1-(acetyloxy)-1,8,9,9a,10,13a,13b,14-octahydro-5,8-dihydroxy-2,7a,10,10,13a-pentamethyl-2H,4H-benzo[a]pyrano[3,4-j]xanthene-4,11(7aH)-dione; [(1S,5R,6R,14R,15S,17R,22S)-10,15-dihydroxy-6,14,18,18,22-pentamethyl-8,19-dioxo-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraen-5-yl] acetate; CHEMBL3581316; CHEBI:156420; HY-N8472; ZINC169649006; NCGC00385361-01; CS-0144645
|
|
CAS | NA | |
PubChem CID | 101565496 | |
ChEMBL ID | CHEMBL3581316 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 484.5 | ALogp: | 3.8 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 119.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 35 | QED Weighted: | 0.57 |
Caco-2 Permeability: | -5.296 | MDCK Permeability: | 0.00003100 |
Pgp-inhibitor: | 0.973 | Pgp-substrate: | 0.028 |
Human Intestinal Absorption (HIA): | 0.05 | 20% Bioavailability (F20%): | 0.161 |
30% Bioavailability (F30%): | 0.479 |
Blood-Brain-Barrier Penetration (BBB): | 0.696 | Plasma Protein Binding (PPB): | 82.53% |
Volume Distribution (VD): | 0.959 | Fu: | 15.49% |
CYP1A2-inhibitor: | 0.087 | CYP1A2-substrate: | 0.245 |
CYP2C19-inhibitor: | 0.039 | CYP2C19-substrate: | 0.273 |
CYP2C9-inhibitor: | 0.448 | CYP2C9-substrate: | 0.283 |
CYP2D6-inhibitor: | 0.595 | CYP2D6-substrate: | 0.074 |
CYP3A4-inhibitor: | 0.683 | CYP3A4-substrate: | 0.469 |
Clearance (CL): | 3.543 | Half-life (T1/2): | 0.252 |
hERG Blockers: | 0.83 | Human Hepatotoxicity (H-HT): | 0.866 |
Drug-inuced Liver Injury (DILI): | 0.249 | AMES Toxicity: | 0.041 |
Rat Oral Acute Toxicity: | 0.95 | Maximum Recommended Daily Dose: | 0.975 |
Skin Sensitization: | 0.345 | Carcinogencity: | 0.735 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.961 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003164 | 0.800 | D03ZZK | 0.279 | ||||
ENC002386 | 0.757 | D09WYX | 0.264 | ||||
ENC001980 | 0.356 | D01XDL | 0.263 | ||||
ENC003846 | 0.338 | D01XWG | 0.263 | ||||
ENC005151 | 0.338 | D02QJH | 0.259 | ||||
ENC003259 | 0.331 | D0P0HT | 0.258 | ||||
ENC005020 | 0.329 | D02JNM | 0.257 | ||||
ENC006083 | 0.322 | D0F7NQ | 0.257 | ||||
ENC005318 | 0.319 | D0D2TN | 0.256 | ||||
ENC005188 | 0.319 | D0G7KJ | 0.255 |