|
Name |
1,2-Dihydro-acetoxydehydroaustin B
|
Molecular Formula | C29H34O11 | |
IUPAC Name* |
[(1S,2S,3R,5S,7R,8R,9S,12S,13R)-8-acetyloxy-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxospiro[10,14,17-trioxapentacyclo[7.6.1.17,12.01,12.02,7]heptadecane-5,3'-oxane]-3-yl] acetate
|
|
SMILES |
C[C@@H]1[C@@]23C(=O)O[C@@]4([C@H]([C@@]5(O2)C(=C)[C@]6(CCC(=O)OC6(C)C)C[C@H]([C@@]5([C@]3(C4=C)C(=O)O1)C)OC(=O)C)OC(=O)C)C
|
|
InChI |
InChI=1S/C29H34O11/c1-13-24(8)20(37-17(5)31)28-14(2)26(11-10-19(32)38-23(26,6)7)12-18(36-16(4)30)25(28,9)27(13)21(33)35-15(3)29(27,40-28)22(34)39-24/h15,18,20H,1-2,10-12H2,3-9H3/t15-,18-,20-,24+,25-,26+,27+,28+,29+/m1/s1
|
|
InChIKey |
UDKVZXSAHWTGCN-MIOOGCPZSA-N
|
|
Synonyms |
1,2-Dihydro-acetoxydehydroaustin B
|
|
CAS | NA | |
PubChem CID | 139588096 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 558.6 | ALogp: | 1.0 |
HBD: | 0 | HBA: | 11 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 141.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 40 | QED Weighted: | 0.281 |
Caco-2 Permeability: | -5.446 | MDCK Permeability: | 0.00006730 |
Pgp-inhibitor: | 0.256 | Pgp-substrate: | 0.049 |
Human Intestinal Absorption (HIA): | 0.273 | 20% Bioavailability (F20%): | 0.99 |
30% Bioavailability (F30%): | 0.92 |
Blood-Brain-Barrier Penetration (BBB): | 0.558 | Plasma Protein Binding (PPB): | 54.35% |
Volume Distribution (VD): | 0.977 | Fu: | 53.66% |
CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.967 |
CYP2C19-inhibitor: | 0.058 | CYP2C19-substrate: | 0.515 |
CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.008 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.03 |
CYP3A4-inhibitor: | 0.453 | CYP3A4-substrate: | 0.846 |
Clearance (CL): | 1.94 | Half-life (T1/2): | 0.074 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.942 |
Drug-inuced Liver Injury (DILI): | 0.973 | AMES Toxicity: | 0.997 |
Rat Oral Acute Toxicity: | 0.893 | Maximum Recommended Daily Dose: | 0.034 |
Skin Sensitization: | 0.765 | Carcinogencity: | 0.979 |
Eye Corrosion: | 0.959 | Eye Irritation: | 0.207 |
Respiratory Toxicity: | 0.849 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004311 | 0.829 | D0H2MO | 0.264 | ||||
ENC005316 | 0.767 | D0KR9U | 0.240 | ||||
ENC003159 | 0.767 | D03ZZK | 0.227 | ||||
ENC003179 | 0.767 | D0Q4SD | 0.226 | ||||
ENC006041 | 0.679 | D0G7KJ | 0.221 | ||||
ENC004811 | 0.646 | D08BDT | 0.221 | ||||
ENC004812 | 0.646 | D0X4RS | 0.209 | ||||
ENC005315 | 0.632 | D06IGU | 0.207 | ||||
ENC003309 | 0.603 | D0EP0C | 0.206 | ||||
ENC004810 | 0.574 | D0X7XG | 0.206 |