![]() |
Name |
Chermesinone A
|
Molecular Formula | C17H22O4 | |
IUPAC Name* |
(7R,8S)-7-hydroxy-3,7-dimethyl-8-[(3S)-3-methyl-2-oxopentyl]-8H-isochromen-6-one
|
|
SMILES |
CC[C@H](C)C(=O)C[C@H]1C2=COC(=CC2=CC(=O)[C@]1(C)O)C
|
|
InChI |
InChI=1S/C17H22O4/c1-5-10(2)15(18)8-14-13-9-21-11(3)6-12(13)7-16(19)17(14,4)20/h6-7,9-10,14,20H,5,8H2,1-4H3/t10-,14-,17+/m0/s1
|
|
InChIKey |
ITPVWOANIWCVEO-RMLVOYDJSA-N
|
|
Synonyms |
Chermesinone A; CHEMBL1801779; CHEBI:67396; DTXSID201118319; BDBM50347536; Q27135856; (7R,8S)-7,8-Dihydro-7-hydroxy-3,7-dimethyl-8-[(3S)-3-methyl-2-oxopentyl]-6H-2-benzopyran-6-one; (7R,8S)-7-Hydroxy-3,7-dimethyl-8-[(3S)-3-methyl-2-oxopentyl]-7,8-dihydro-6H-isochromen-6-one; 1300040-79-2
|
|
CAS | 1300040-79-2 | |
PubChem CID | 53355009 | |
ChEMBL ID | CHEMBL1801779 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 290.4 | ALogp: | 1.1 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.861 |
Caco-2 Permeability: | -4.601 | MDCK Permeability: | 0.00002610 |
Pgp-inhibitor: | 0.981 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.137 | 20% Bioavailability (F20%): | 0.847 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.895 | Plasma Protein Binding (PPB): | 76.35% |
Volume Distribution (VD): | 1.455 | Fu: | 29.27% |
CYP1A2-inhibitor: | 0.355 | CYP1A2-substrate: | 0.181 |
CYP2C19-inhibitor: | 0.222 | CYP2C19-substrate: | 0.769 |
CYP2C9-inhibitor: | 0.146 | CYP2C9-substrate: | 0.082 |
CYP2D6-inhibitor: | 0.061 | CYP2D6-substrate: | 0.079 |
CYP3A4-inhibitor: | 0.304 | CYP3A4-substrate: | 0.569 |
Clearance (CL): | 3.219 | Half-life (T1/2): | 0.839 |
hERG Blockers: | 0.065 | Human Hepatotoxicity (H-HT): | 0.849 |
Drug-inuced Liver Injury (DILI): | 0.106 | AMES Toxicity: | 0.858 |
Rat Oral Acute Toxicity: | 0.928 | Maximum Recommended Daily Dose: | 0.927 |
Skin Sensitization: | 0.823 | Carcinogencity: | 0.949 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.05 |
Respiratory Toxicity: | 0.91 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004373 | ![]() |
0.629 | D06WTZ | ![]() |
0.225 | ||
ENC002774 | ![]() |
0.553 | D07JGT | ![]() |
0.214 | ||
ENC005364 | ![]() |
0.475 | D0WY9N | ![]() |
0.210 | ||
ENC004374 | ![]() |
0.458 | D0O6KE | ![]() |
0.210 | ||
ENC004375 | ![]() |
0.441 | D0G7DJ | ![]() |
0.209 | ||
ENC003987 | ![]() |
0.433 | D06LYG | ![]() |
0.205 | ||
ENC004587 | ![]() |
0.432 | D04GJN | ![]() |
0.204 | ||
ENC004586 | ![]() |
0.430 | D0A4JK | ![]() |
0.203 | ||
ENC004593 | ![]() |
0.425 | D0I5HV | ![]() |
0.202 | ||
ENC004592 | ![]() |
0.425 | D0P1FO | ![]() |
0.200 |