![]() |
Name |
Phomopsone C
|
Molecular Formula | C22H28O7 | |
IUPAC Name* |
butyl (2'R,7R,8R)-7-hydroxy-3,7-dimethyl-2'-[(2S)-2-methylbutanoyl]-6-oxospiro[isochromene-8,3'-oxirane]-2'-carboxylate
|
|
SMILES |
CCCCOC(=O)[C@@]1([C@@]2(O1)C3=COC(=CC3=CC(=O)[C@]2(C)O)C)C(=O)[C@@H](C)CC
|
|
InChI |
InChI=1S/C22H28O7/c1-6-8-9-27-19(25)21(18(24)13(3)7-2)22(29-21)16-12-28-14(4)10-15(16)11-17(23)20(22,5)26/h10-13,26H,6-9H2,1-5H3/t13-,20-,21+,22+/m0/s1
|
|
InChIKey |
DGWZNXVWPPDPOP-KZPWJOJVSA-N
|
|
Synonyms |
Phomopsone C
|
|
CAS | NA | |
PubChem CID | 156582438 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 404.5 | ALogp: | 1.6 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 29 | QED Weighted: | 0.3 |
Caco-2 Permeability: | -4.954 | MDCK Permeability: | 0.00002060 |
Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.028 |
Human Intestinal Absorption (HIA): | 0.35 | 20% Bioavailability (F20%): | 0.978 |
30% Bioavailability (F30%): | 0.585 |
Blood-Brain-Barrier Penetration (BBB): | 0.757 | Plasma Protein Binding (PPB): | 77.51% |
Volume Distribution (VD): | 1.965 | Fu: | 21.53% |
CYP1A2-inhibitor: | 0.614 | CYP1A2-substrate: | 0.903 |
CYP2C19-inhibitor: | 0.719 | CYP2C19-substrate: | 0.86 |
CYP2C9-inhibitor: | 0.565 | CYP2C9-substrate: | 0.004 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.051 |
CYP3A4-inhibitor: | 0.62 | CYP3A4-substrate: | 0.929 |
Clearance (CL): | 4.256 | Half-life (T1/2): | 0.808 |
hERG Blockers: | 0.05 | Human Hepatotoxicity (H-HT): | 0.918 |
Drug-inuced Liver Injury (DILI): | 0.953 | AMES Toxicity: | 0.972 |
Rat Oral Acute Toxicity: | 0.714 | Maximum Recommended Daily Dose: | 0.511 |
Skin Sensitization: | 0.821 | Carcinogencity: | 0.95 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.027 |
Respiratory Toxicity: | 0.165 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002773 | ![]() |
0.441 | D0WY9N | ![]() |
0.258 | ||
ENC004374 | ![]() |
0.402 | D03SXE | ![]() |
0.232 | ||
ENC002774 | ![]() |
0.400 | D0X2LV | ![]() |
0.228 | ||
ENC005364 | ![]() |
0.400 | D0E9WO | ![]() |
0.225 | ||
ENC004373 | ![]() |
0.388 | D0HD9K | ![]() |
0.222 | ||
ENC003987 | ![]() |
0.326 | D0G7DJ | ![]() |
0.222 | ||
ENC004586 | ![]() |
0.306 | D0H2SY | ![]() |
0.219 | ||
ENC002329 | ![]() |
0.303 | D00AEQ | ![]() |
0.215 | ||
ENC002328 | ![]() |
0.303 | D05RXI | ![]() |
0.213 | ||
ENC002775 | ![]() |
0.303 | D09WYX | ![]() |
0.212 |