![]() |
Name |
Chermesinone B
|
Molecular Formula | C18H20O5 | |
IUPAC Name* |
(6aR,9S,9aS)-3,6a-dimethyl-9-[(2S)-2-methylbutanoyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione
|
|
SMILES |
CC[C@H](C)C(=O)[C@@H]1[C@H]2C3=COC(=CC3=CC(=O)[C@@]2(OC1=O)C)C
|
|
InChI |
InChI=1S/C18H20O5/c1-5-9(2)16(20)14-15-12-8-22-10(3)6-11(12)7-13(19)18(15,4)23-17(14)21/h6-9,14-15H,5H2,1-4H3/t9-,14-,15+,18-/m0/s1
|
|
InChIKey |
MZMGICPQNSXAGE-SRSSHDMCSA-N
|
|
Synonyms |
Chermesinone B; CHEMBL1801780; CHEBI:67397; BDBM50347537; Q27135857; rel-(6aR,9S,9aS)-3,6a-Dimethyl-9-[(2S)-2-methylbutanoyl]-9,9a-dihydro-6H-furo[2,3-h]isochromene-6,8(6aH)-dione
|
|
CAS | NA | |
PubChem CID | 53355010 | |
ChEMBL ID | CHEMBL1801780 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 316.3 | ALogp: | 1.7 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 69.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.59 |
Caco-2 Permeability: | -4.697 | MDCK Permeability: | 0.00001920 |
Pgp-inhibitor: | 0.943 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.032 | 20% Bioavailability (F20%): | 0.421 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.914 | Plasma Protein Binding (PPB): | 64.95% |
Volume Distribution (VD): | 1.975 | Fu: | 43.49% |
CYP1A2-inhibitor: | 0.322 | CYP1A2-substrate: | 0.329 |
CYP2C19-inhibitor: | 0.212 | CYP2C19-substrate: | 0.755 |
CYP2C9-inhibitor: | 0.076 | CYP2C9-substrate: | 0.042 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.084 |
CYP3A4-inhibitor: | 0.477 | CYP3A4-substrate: | 0.483 |
Clearance (CL): | 6.028 | Half-life (T1/2): | 0.577 |
hERG Blockers: | 0.086 | Human Hepatotoxicity (H-HT): | 0.704 |
Drug-inuced Liver Injury (DILI): | 0.694 | AMES Toxicity: | 0.356 |
Rat Oral Acute Toxicity: | 0.61 | Maximum Recommended Daily Dose: | 0.879 |
Skin Sensitization: | 0.868 | Carcinogencity: | 0.873 |
Eye Corrosion: | 0.031 | Eye Irritation: | 0.037 |
Respiratory Toxicity: | 0.956 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002775 | ![]() |
0.556 | D0O6KE | ![]() |
0.220 | ||
ENC002773 | ![]() |
0.553 | D0K7LU | ![]() |
0.220 | ||
ENC005364 | ![]() |
0.531 | D0I5DS | ![]() |
0.205 | ||
ENC004373 | ![]() |
0.519 | D06WTZ | ![]() |
0.203 | ||
ENC004374 | ![]() |
0.512 | D0A4JK | ![]() |
0.202 | ||
ENC002613 | ![]() |
0.429 | D07JGT | ![]() |
0.200 | ||
ENC004375 | ![]() |
0.400 | D09JBP | ![]() |
0.200 | ||
ENC003987 | ![]() |
0.397 | D0P1FO | ![]() |
0.200 | ||
ENC004586 | ![]() |
0.387 | D0WY9N | ![]() |
0.200 | ||
ENC002611 | ![]() |
0.379 | D0MB8I | ![]() |
0.198 |