![]() |
Name |
Pestaphilone G
|
Molecular Formula | C20H28O6 | |
IUPAC Name* |
3-(2,3-dihydroxy-4,6-dimethyloct-4-en-2-yl)-7,8-dihydroxy-7-methyl-8H-isochromen-6-one
|
|
SMILES |
CCC(C)C=C(C)C(O)C(C)(O)C1=CC2=CC(=O)C(C)(O)C(O)C2=CO1
|
|
InChI |
InChI=1S/C20H28O6/c1-6-11(2)7-12(3)17(22)20(5,25)16-9-13-8-15(21)19(4,24)18(23)14(13)10-26-16/h7-11,17-18,22-25H,6H2,1-5H3/b12-7+/t11-,17+,18+,19+,20+/m0/s1
|
|
InChIKey |
POYHFTSKSGRZEJ-AKETYDQOSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 364.44 | ALogp: | 1.5 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 26 | QED Weighted: | 0.556 |
Caco-2 Permeability: | -4.848 | MDCK Permeability: | 0.00002080 |
Pgp-inhibitor: | 0.454 | Pgp-substrate: | 0.928 |
Human Intestinal Absorption (HIA): | 0.943 | 20% Bioavailability (F20%): | 0.852 |
30% Bioavailability (F30%): | 0.255 |
Blood-Brain-Barrier Penetration (BBB): | 0.841 | Plasma Protein Binding (PPB): | 83.47% |
Volume Distribution (VD): | 1.566 | Fu: | 13.72% |
CYP1A2-inhibitor: | 0.036 | CYP1A2-substrate: | 0.13 |
CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.804 |
CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.079 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.063 |
CYP3A4-inhibitor: | 0.081 | CYP3A4-substrate: | 0.524 |
Clearance (CL): | 1.653 | Half-life (T1/2): | 0.459 |
hERG Blockers: | 0.182 | Human Hepatotoxicity (H-HT): | 0.808 |
Drug-inuced Liver Injury (DILI): | 0.078 | AMES Toxicity: | 0.794 |
Rat Oral Acute Toxicity: | 0.901 | Maximum Recommended Daily Dose: | 0.876 |
Skin Sensitization: | 0.277 | Carcinogencity: | 0.943 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.831 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004593 | ![]() |
0.722 | D08HUC | ![]() |
0.202 | ||
ENC004586 | ![]() |
0.588 | D0Z1WA | ![]() |
0.202 | ||
ENC004587 | ![]() |
0.551 | D0E9KA | ![]() |
0.200 | ||
ENC004589 | ![]() |
0.522 | D06REO | ![]() |
0.187 | ||
ENC004594 | ![]() |
0.516 | D0L7AS | ![]() |
0.183 | ||
ENC004590 | ![]() |
0.500 | D0M8RC | ![]() |
0.183 | ||
ENC004591 | ![]() |
0.489 | D02ZGI | ![]() |
0.181 | ||
ENC004373 | ![]() |
0.465 | D0L5FY | ![]() |
0.178 | ||
ENC001876 | ![]() |
0.435 | D02ZJI | ![]() |
0.177 | ||
ENC002773 | ![]() |
0.425 | D0K5CB | ![]() |
0.177 |