![]() |
Name |
Koninginin J
|
Molecular Formula | C16H24O5 | |
IUPAC Name* |
(2S,6S)-6-hydroxy-2-[(1S)-1-hydroxy-6-oxoheptyl]-2,3,4,6,7,8-hexahydrochromen-5-one
|
|
SMILES |
CC(=O)CCCC[C@@H]([C@@H]1CCC2=C(O1)CC[C@@H](C2=O)O)O
|
|
InChI |
InChI=1S/C16H24O5/c1-10(17)4-2-3-5-12(18)15-8-6-11-14(21-15)9-7-13(19)16(11)20/h12-13,15,18-19H,2-9H2,1H3/t12-,13-,15-/m0/s1
|
|
InChIKey |
JXHGVDMSZCJROO-YDHLFZDLSA-N
|
|
Synonyms |
Koninginin J
|
|
CAS | NA | |
PubChem CID | 139583113 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.36 | ALogp: | 0.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.734 |
Caco-2 Permeability: | -4.682 | MDCK Permeability: | 0.00003230 |
Pgp-inhibitor: | 0.989 | Pgp-substrate: | 0.167 |
Human Intestinal Absorption (HIA): | 0.584 | 20% Bioavailability (F20%): | 0.926 |
30% Bioavailability (F30%): | 0.741 |
Blood-Brain-Barrier Penetration (BBB): | 0.729 | Plasma Protein Binding (PPB): | 66.02% |
Volume Distribution (VD): | 0.341 | Fu: | 33.84% |
CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.626 |
CYP2C19-inhibitor: | 0.072 | CYP2C19-substrate: | 0.416 |
CYP2C9-inhibitor: | 0.023 | CYP2C9-substrate: | 0.33 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.558 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.227 |
Clearance (CL): | 11.85 | Half-life (T1/2): | 0.78 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.167 |
Drug-inuced Liver Injury (DILI): | 0.241 | AMES Toxicity: | 0.191 |
Rat Oral Acute Toxicity: | 0.123 | Maximum Recommended Daily Dose: | 0.564 |
Skin Sensitization: | 0.617 | Carcinogencity: | 0.352 |
Eye Corrosion: | 0.016 | Eye Irritation: | 0.302 |
Respiratory Toxicity: | 0.322 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005890 | ![]() |
0.785 | D0I4DQ | ![]() |
0.245 | ||
ENC005466 | ![]() |
0.731 | D0V0IX | ![]() |
0.243 | ||
ENC005891 | ![]() |
0.681 | D06FEA | ![]() |
0.233 | ||
ENC005893 | ![]() |
0.627 | D09QEI | ![]() |
0.231 | ||
ENC005927 | ![]() |
0.562 | D00AEQ | ![]() |
0.231 | ||
ENC002146 | ![]() |
0.562 | D01WUA | ![]() |
0.223 | ||
ENC002643 | ![]() |
0.562 | D02IIW | ![]() |
0.222 | ||
ENC003134 | ![]() |
0.506 | D00CTS | ![]() |
0.222 | ||
ENC005887 | ![]() |
0.506 | D04ATM | ![]() |
0.221 | ||
ENC005892 | ![]() |
0.488 | D0XN8C | ![]() |
0.219 |