|
Name |
11-Hydroxymonocerin
|
Molecular Formula | C16H20O7 | |
IUPAC Name* |
(2S,3aS,9bS)-6-hydroxy-2-[(1R)-1-hydroxypropyl]-7,8-dimethoxy-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-5-one
|
|
SMILES |
CC[C@H]([C@@H]1C[C@H]2[C@@H](O1)C3=CC(=C(C(=C3C(=O)O2)O)OC)OC)O
|
|
InChI |
InChI=1S/C16H20O7/c1-4-8(17)9-6-11-14(22-9)7-5-10(20-2)15(21-3)13(18)12(7)16(19)23-11/h5,8-9,11,14,17-18H,4,6H2,1-3H3/t8-,9+,11+,14+/m1/s1
|
|
InChIKey |
IELGRTIPFVIRGM-DKZXUEBISA-N
|
|
Synonyms |
11-hydroxymonocerin; 11(R)-hydroxymonocerin; CHEMBL497860; SCHEMBL21776766; (2S,3aS,9bS)-6-hydroxy-2-[(1R)-1-hydroxypropyl]-7,8-dimethoxy-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-5-one
|
|
CAS | NA | |
PubChem CID | 25111599 | |
ChEMBL ID | CHEMBL497860 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 324.32 | ALogp: | 1.9 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.819 |
Caco-2 Permeability: | -4.998 | MDCK Permeability: | 0.00003190 |
Pgp-inhibitor: | 0.056 | Pgp-substrate: | 0.069 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.755 | Plasma Protein Binding (PPB): | 59.36% |
Volume Distribution (VD): | 0.816 | Fu: | 19.09% |
CYP1A2-inhibitor: | 0.064 | CYP1A2-substrate: | 0.594 |
CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.849 |
CYP2C9-inhibitor: | 0.034 | CYP2C9-substrate: | 0.756 |
CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.294 |
CYP3A4-inhibitor: | 0.191 | CYP3A4-substrate: | 0.252 |
Clearance (CL): | 10.25 | Half-life (T1/2): | 0.605 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.274 |
Drug-inuced Liver Injury (DILI): | 0.62 | AMES Toxicity: | 0.256 |
Rat Oral Acute Toxicity: | 0.353 | Maximum Recommended Daily Dose: | 0.113 |
Skin Sensitization: | 0.823 | Carcinogencity: | 0.386 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.137 |
Respiratory Toxicity: | 0.809 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003791 | 1.000 | D0L1JW | 0.312 | ||||
ENC003705 | 1.000 | D04TDQ | 0.298 | ||||
ENC005388 | 0.750 | D0D4HN | 0.276 | ||||
ENC002512 | 0.750 | D0F7CS | 0.272 | ||||
ENC002513 | 0.750 | D09PJX | 0.270 | ||||
ENC000799 | 0.722 | D06GCK | 0.269 | ||||
ENC003612 | 0.722 | D02LZB | 0.255 | ||||
ENC003801 | 0.722 | D0G4KG | 0.247 | ||||
ENC003205 | 0.571 | D09DHY | 0.243 | ||||
ENC005556 | 0.563 | D0C1SF | 0.243 |